| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (1R,2R)-(-)-2-Benzyloxycyclopentylamine Basic information |
| Product Name: | (1R,2R)-(-)-2-Benzyloxycyclopentylamine | | Synonyms: | (1R,2R)-2-(Phenylmethoxy)cyclopentanamine;(1R,2R)-1-Amino-2-benzyloxycyclopentane 97%;(1r-trans)-2-(phenylmethoxy)cyclopentanamine;(1R,2R)-(-)-2-BENZYLOXYCYCLOPENTYLAMINE, CHIPROS 99+%, EE 98;[1R,2R]-trans-2-Benzyl-oxycyclopentylamine;(1R,2R)-(-)-2-Benzyloxycyclopentylamine, ChiPros 99+%, ee 98%;(1R,2R)-(-)-2-Benzyloxycyclopentylamine, ChiPros;(1r-Tran | | CAS: | 181657-56-7 | | MF: | C12H17NO | | MW: | 191.27 | | EINECS: | 624-919-7 | | Product Categories: | | | Mol File: | 181657-56-7.mol |  |
| | (1R,2R)-(-)-2-Benzyloxycyclopentylamine Chemical Properties |
| Melting point | 23℃ | | Boiling point | 90-93°C 0,23mm | | density | 0.983 | | refractive index | 1.5305 | | Fp | >110°C | | storage temp. | 2-8°C | | pka | 10.11±0.40(Predicted) | | form | liquid | | Appearance | Colorless to light yellow Liquid | | Water Solubility | Not miscible or difficult to mix with water. | | Sensitive | Air Sensitive | | InChI | 1S/C12H17NO/c13-11-7-4-8-12(11)14-9-10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9,13H2/t11-,12-/m1/s1 | | InChIKey | JIMSXLUBRRQALI-VXGBXAGGSA-N | | SMILES | N[C@@H]1CCC[C@H]1OCc2ccccc2 |
| Hazard Codes | C | | Risk Statements | 34-21/22 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 2735 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |
| Provider | Language |
|
ALFA
| English |
| | (1R,2R)-(-)-2-Benzyloxycyclopentylamine Usage And Synthesis |
| Uses | (1R,2R)-(-)-2-Benzyloxycyclopentylamine is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff field. |
| | (1R,2R)-(-)-2-Benzyloxycyclopentylamine Preparation Products And Raw materials |
|