| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (1S,2S)-(+)-2-Benzyloxycyclopentylamine Basic information |
| Product Name: | (1S,2S)-(+)-2-Benzyloxycyclopentylamine | | Synonyms: | (1S,2S)-(+)-2-BENZYLOXYCYCLOPENTYLAMINE;(1S,2S)-2-BENZYLOXYCYCLOPENTYLAMINE;(1S-TRANS)-2-(PHENYLMETHOXY)CYCLOPENTANEAMINE;(1s,2s)-1-amino-2-benzyloxycyclopentane;(1s-trans)-2-(phenylmethoxy)cyclopentanamine;(1S,2S)-(+)-2-BENZYLOXYCYCLOPENTYLAMINE: CHIPROS 99%, EE 99%;(1S,2S)-(+)-2-BENZYLOXYCYCLOPENTYLAMINE, CHIPROS 99+%, EE 99;[1S,2S]-trans-2-Benzyl-oxycyclopentylamine | | CAS: | 181657-57-8 | | MF: | C12H17NO | | MW: | 191.27 | | EINECS: | 623-933-0 | | Product Categories: | | | Mol File: | 181657-57-8.mol |  |
| | (1S,2S)-(+)-2-Benzyloxycyclopentylamine Chemical Properties |
| Melting point | 23℃ | | alpha | 73 º (C=1 IN CHLOROFORM) | | Boiling point | 90-93°C 0,2mm | | density | 0.983 | | refractive index | 1.5305 | | Fp | >110°C | | storage temp. | 2-8°C | | pka | 10.11±0.40(Predicted) | | form | liquid | | Water Solubility | Not miscible or difficult to mix in water. | | Sensitive | Air Sensitive | | BRN | 9554058 | | InChI | 1S/C12H17NO/c13-11-7-4-8-12(11)14-9-10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9,13H2/t11-,12-/m0/s1 | | InChIKey | JIMSXLUBRRQALI-RYUDHWBXSA-N | | SMILES | N[C@H]1CCC[C@@H]1OCc2ccccc2 |
| Hazard Codes | C | | Risk Statements | 34-21/22 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 2735 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Oral Aquatic Chronic 2 Eye Dam. 1 Skin Corr. 1B Skin Sens. 1 |
| Provider | Language |
|
ALFA
| English |
| | (1S,2S)-(+)-2-Benzyloxycyclopentylamine Usage And Synthesis |
| Uses | (1S,2S)-(+)-2-Benzyloxycyclopentylamine is a important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field. Chiral amines play an important role in stereoselective organic synthesis. They are used directly as resolving agents, building blocks or chiral auxiliaries. |
| | (1S,2S)-(+)-2-Benzyloxycyclopentylamine Preparation Products And Raw materials |
|