|
|
| | Budesonide Impurity 18 Basic information |
| Product Name: | Budesonide Impurity 18 | | Synonyms: | Budesonide Impurity 18;2-((8S,10S,13S,14S,16R,17S)-16-Acetoxy-17-hydroxy-10,13-dimethyl-3-oxo-6,7,8,10,12,13,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl acetate;Pregna-1,4,9(11)-triene-3,20-dione, 16,21-bis(acetyloxy)-17-hydroxy-, (16α)-;(16a)-16-(Acetyloxy)-17-hydroxy-3,20-dioxopregna-1,4,9(11)-trien-21-yl acetate;Budesonide Impurity 96 | | CAS: | 95943-95-6 | | MF: | C25H30O7 | | MW: | 442.51 | | EINECS: | | | Product Categories: | | | Mol File: | 95943-95-6.mol |  |
| | Budesonide Impurity 18 Chemical Properties |
| Melting point | 191-199 °C(Solv: acetone (67-64-1)) | | Boiling point | 589.8±50.0 °C(Predicted) | | density | 1.29±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 11.61±0.70(Predicted) | | Major Application | pharmaceutical | | InChIKey | BVUMWMSJZHOLBQ-CBOJUQFSSA-N | | SMILES | O=C1C=C[C@@](C2=CC[C@@]([C@](C(COC(C)=O)=O)(O)[C@H](OC(C)=O)C3)(C)[C@]3([H])[C@]2([H])CC4)(C)C4=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Skin Sens. 1 |
| | Budesonide Impurity 18 Usage And Synthesis |
| Uses | (16α)-16-(Acetyloxy)-17-hydroxy-3,20-dioxopregna-1,4,9(11)-trien-21-yl acetate (USP PAI) is intended for use in analytical testing to detect, identify, and measure pharmaceutical impurities. |
| | Budesonide Impurity 18 Preparation Products And Raw materials |
|