|
|
| | 2-DECYL-1-TETRADECANOL Basic information |
| | 2-DECYL-1-TETRADECANOL Chemical Properties |
| Melting point | 17-20 °C(lit.) | | Boiling point | 271-275 °C/33 mmHg(lit.) | | density | 0.842 g/mL at 25 °C(lit.) | | vapor pressure | 0.1Pa at 38℃ | | refractive index | n20/D 1.457(lit.) | | Fp | 113 °C | | storage temp. | Store at room temperature | | pka | 15.03±0.10(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | Cosmetics Ingredients Functions | SKIN CONDITIONING SKIN CONDITIONING - EMOLLIENT VISCOSITY CONTROLLING | | InChI | InChI=1S/C24H50O/c1-3-5-7-9-11-13-14-16-18-20-22-24(23-25)21-19-17-15-12-10-8-6-4-2/h24-25H,3-23H2,1-2H3 | | InChIKey | CAYHVMBQBLYQMT-UHFFFAOYSA-N | | SMILES | C(O)C(CCCCCCCCCC)CCCCCCCCCCCC | | LogP | 10.59 at 20℃ | | EPA Substance Registry System | 1-Tetradecanol, 2-decyl- (58670-89-6) |
| WGK Germany | nwg | | TSCA | TSCA listed | | HS Code | 2905.19.9090 | | Storage Class | 10 - Combustible liquids |
| | 2-DECYL-1-TETRADECANOL Usage And Synthesis |
| Uses | 2-Decyl-1-tetradecanol may be used in the preparation of 2-decyltetradecyl (4-nitrophenyl)[11-([(2,5-dioxotetrahydro-1H-1-pyrrolyl)oxy]carbonyloxy)undecyl]phosphonate. | | General Description | 2-Decyl-1-tetradecanol participates in the preparation of monosaccharide glycolipid. |
| | 2-DECYL-1-TETRADECANOL Preparation Products And Raw materials |
|