| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Bis(2,4,6-trimethylphenyl)phosphorus chloride Basic information |
| Product Name: | Bis(2,4,6-trimethylphenyl)phosphorus chloride | | Synonyms: | bis(2,4,6-trimethylphenyl)chlorophosphine;BIS(2,4,6-TRIMETHYLPHENYL)PHOSPHINE;DIMESITYLPHOSPHINE;Bis(2,4,6-trimethylphenyl)phosphorus chloride;Bis(2,4,6-trimethylphenyl)phosphorus chloride 95%;Phosphinous chloride, P,P-bis(2,4,6-trimethylphenyl)-;Chlorodimesitylphosphane;chloro-bis(2,4,6-trimethylphenyl)phosphane | | CAS: | 67950-05-4 | | MF: | C18H22ClP | | MW: | 304.79 | | EINECS: | | | Product Categories: | | | Mol File: | 67950-05-4.mol |  |
| | Bis(2,4,6-trimethylphenyl)phosphorus chloride Chemical Properties |
| Melting point | 80-85°C | | form | solid | | InChI | 1S/C18H22ClP/c1-11-7-13(3)17(14(4)8-11)20(19)18-15(5)9-12(2)10-16(18)6/h7-10H,1-6H3 | | InChIKey | AZIJQQZQDFCANM-UHFFFAOYSA-N | | SMILES | Cc1cc(C)c(P(Cl)c2c(C)cc(C)cc2C)c(C)c1 |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8 / PGII | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | Bis(2,4,6-trimethylphenyl)phosphorus chloride Usage And Synthesis |
| Uses | bis(2,4,6-Trimethylphenyl)phosphine acts as a reagent for the synthesis, properties and reactivity of bis(2,4,6-trimethylphenyl)phosphorus chloride. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand
reaction type: Cross Couplings |
| | Bis(2,4,6-trimethylphenyl)phosphorus chloride Preparation Products And Raw materials |
|