| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- TriMesitylphosphine
-
- $1.00
-
2026-08-07
- CAS:23897-15-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20 tons
- TRIMESITYLPHOSPHINE
-
- $1.00
-
2019-07-06
- CAS:23897-15-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kg
|
| | TRIMESITYLPHOSPHINE Basic information |
| Product Name: | TRIMESITYLPHOSPHINE | | Synonyms: | TRIMESITYLPHOSPHINE;TRIS(2,4,6-TRIMETHYLPHENYL)PHOSPHINE, 97 %;Trimesitylphosphine,98%;Trismesitylphosphine;Trimesitylphosphine,97%;Tris(2,4,6-triMethylphenyl)phosphine,98%;Tris(2,4,6-triMethylphenyl)phosphine 97%;Phosphine, tris(2,4,6-trimethylphenyl)- | | CAS: | 23897-15-6 | | MF: | C27H33P | | MW: | 388.52 | | EINECS: | | | Product Categories: | Achiral Phosphine;Aryl Phosphine;Ligand;organophosphine ligand | | Mol File: | 23897-15-6.mol |  |
| | TRIMESITYLPHOSPHINE Chemical Properties |
| Melting point | 185-188 °C (lit.) | | Boiling point | 491.1±45.0 °C(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | color | white | | Water Solubility | Insoluble in water. | | InChI | 1S/C27H33P/c1-16-10-19(4)25(20(5)11-16)28(26-21(6)12-17(2)13-22(26)7)27-23(8)14-18(3)15-24(27)9/h10-15H,1-9H3 | | InChIKey | IDXDWPWXHTXJMZ-UHFFFAOYSA-N | | SMILES | Cc1cc(C)c(P(c2c(C)cc(C)cc2C)c3c(C)cc(C)cc3C)c(C)c1 | | CAS DataBase Reference | 23897-15-6(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids |
| | TRIMESITYLPHOSPHINE Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | It is used as an intermediate in organic synthesis. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand | | Purification Methods | It recrystallises from EtOH [Boert et al. J Am Chem Soc 109 7781 1987]. The P-methyl iodide has m 269o (yellow powder from EtOH or H2O). [Beilstein 16 H 774.] |
| | TRIMESITYLPHOSPHINE Preparation Products And Raw materials |
|