|
|
| | Triphenylsulfonium nonaflate Basic information |
| Product Name: | Triphenylsulfonium nonaflate | | Synonyms: | Triphenyl sulfonium salt with 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonic acid(1:1);Triphenylsulfonium nonaflate;Triphenylsulfonium perfluoro-1-butanesufonate;TriphenylsulfoniuM perfluoro-1-butanesufonate electronic grade, >=99%;TRIPHENYLSULFONIUM PERFLUORO-1-;Triphenylsulfonium 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;Triphenyl-sulfonium-1,1,2,2,3,3,4,4,4-nonafluoro-1-butane- sulfonate;Triphenylsulfonium perfluoro-1-butanesufonate | | CAS: | 144317-44-2 | | MF: | C22H15F9O3S2 | | MW: | 562.46 | | EINECS: | | | Product Categories: | Cationic PhotoinitiatorsSelf Assembly&Contact Printing;Organic Photoinitiators;Photoacid Generators (PAGs);Photoresists;Polymerization Initiators | | Mol File: | 144317-44-2.mol |  |
| | Triphenylsulfonium nonaflate Chemical Properties |
| Melting point | 84-88 °C (lit.) | | solubility | PGMEA: ~50% | | InChI | InChI=1S/C18H15S.C4HF9O3S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h1-15H;(H,14,15,16)/q+1;/p-1 | | InChIKey | VLLPVDKADBYKLM-UHFFFAOYSA-M | | SMILES | [S+](C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1.C(F)(F)(C(F)(F)S([O-])(=O)=O)C(F)(F)C(F)(F)F | | EPA Substance Registry System | Sulfonium, triphenyl-, salt with 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonic acid (1:1) (144317-44-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2930909899 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Triphenylsulfonium nonaflate Usage And Synthesis |
| Uses | Cationic photoinitiator. Photoacid generator. | | Application | Triphenylsulfonium nonaflate is used as a light stabilizer in polymers and films, due to its ability to absorb ultraviolet radiation.
| | Synthesis |
Add a mixed compound solvent ethyl acetate and water solution into a 1L four-neck flask equipped with a stirring blade, condenser tube, and thermometer, and turn on the stirring. Add triphenylthiobromide to the system, slowly add sodium perfluorobutane sulfonate to the reaction system, and raise the temperature to 60°C. Incubate the reaction for 9 hours, monitor its progress, take samples to detect completion, and cool it to 0-5°C—centrifugation to obtain wet crude triphenyl sulfur perfluorobutane sulfonium salt. The crude product was recrystallized with a mixed solution of n-butanol and water under stirring at 85°C for 40min, and after cooling to 0-5°C, the obtained solid was dried below 80°C to obtain 150.32g of solid product. The product yield was 81.17%.
|
| | Triphenylsulfonium nonaflate Preparation Products And Raw materials |
|