|
|
| | L-Cysteine hydrochloride hydrate, 98.5-101.5% Basic information |
| Product Name: | L-Cysteine hydrochloride hydrate, 98.5-101.5% | | Synonyms: | (2r)-2-Azaniumyl-3-Sulfanyl-Propanoate;L-Cysteine hydrochloride hydrate, 98.5%;L-Cysteine hydrochloride hydrate, 98.5-101.0%;L-Cysteine hydrochloride hydrate, 98.5-101.5% 5GR;L-CYSTEINE HYDROCHLORIDE HYDRATE, 98.5-101.5% USP/EP/BP;(R)-2-Amino-3-mercaptopropanoic acid hydrochloride xhydrate;L-Cysteine hydrochloride hydrate;L-Cysteine hydrochloride hydrate, 98.5-101.5% | | CAS: | 345909-32-2 | | MF: | C3H10ClNO3S | | MW: | 175.6344 | | EINECS: | 629-054-9 | | Product Categories: | | | Mol File: | 345909-32-2.mol |  |
| | L-Cysteine hydrochloride hydrate, 98.5-101.5% Chemical Properties |
| storage temp. | 2-8°C | | form | solid | | color | white | | Optical Rotation | [α]23/D +5.2°, c = 2 in 5 M HCl | | Major Application | peptide synthesis | | InChI | 1S/C3H7NO2S.ClH.H2O/c4-2(1-7)3(5)6;;/h2,7H,1,4H2,(H,5,6);1H;1H2/t2-;;/m0../s1 | | InChIKey | QIJRTFXNRTXDIP-JIZZDEOASA-N | | SMILES | Cl[H].[H]O[H].N[C@@H](CS)C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-26/36 | | WGK Germany | 3 | | HS Code | 29309090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | L-Cysteine hydrochloride hydrate, 98.5-101.5% Usage And Synthesis |
| Chemical Properties | White crystalline powder or colorless crystals | | Uses | is the Hydrated form of L-Cysteine(C995000). L-Cysteine is a non-essential amino acid that can be synthesized by the human body under normal physiological conditions if a sufficient quantity of methionine is available. L-Cysteine is commonly used as a precursor in the food and pharmaceutical industries. L-Cysteine is used as a processing aid for baking, as an additive in cigarettes, as well as in the preparation of meat flavours. Acetylcysteine EP Impurity B | | Definition | ChEBI: L-cysteine hydrochloride hydrate is a hydrate that is the monohydrate form of L-cysteine hydrochloride. It has a role as an EC 4.3.1.3 (histidine ammonia-lyase) inhibitor, a flour treatment agent and a human metabolite. It contains a L-cysteine hydrochloride. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | L-Cysteine hydrochloride hydrate, 98.5-101.5% Preparation Products And Raw materials |
|