| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 2 3 4 5 6-Pentafluorobenzylzinc chlorid& Basic information |
| Product Name: | 2 3 4 5 6-Pentafluorobenzylzinc chlorid& | | Synonyms: | 1,2,3,4,5-pentafluoro-6-methanidylbenzene;chlorozinc(1+);2,3,4,5,6-Pentafluorobenzylzinc chloride solution 0.5 in THF;2,3,4,5,6-Pentafluorobenzylzinc chloride solution 0.5M in THF;2,3,4,5,6-pentafluorobenzylzinc chloride solution;2 3 4 5 6-Pentafluorobenzylzinc chlorid& | | CAS: | 308796-02-3 | | MF: | C7H2ClF5Zn | | MW: | 281.925796 | | EINECS: | | | Product Categories: | Alkyl;Organozinc Halides;Reike and Organozinc Reagents | | Mol File: | 308796-02-3.mol |  |
| | 2 3 4 5 6-Pentafluorobenzylzinc chlorid& Chemical Properties |
| Boiling point | 65 °C | | density | 0.99 g/mL at 25 °C | | Fp | 1 °F | | storage temp. | 2-8°C | | InChI | 1S/C7H2F5.ClH.Zn/c1-2-3(8)5(10)7(12)6(11)4(2)9;;/h1H2;1H;/q;;+1/p-1 | | InChIKey | GGNRNMYEDWCPQV-UHFFFAOYSA-M | | SMILES | Fc1c(F)c(F)c(C[Zn]Cl)c(F)c1F |
| Hazard Codes | Xi,F,Xn | | Risk Statements | 36/37-19-11-40 | | Safety Statements | 16-29-33-36/37-26 | | RIDADR | UN 2056 3/PG 2 | | WGK Germany | - | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral
Carc. 2
Eye Irrit. 2
Flam. Liq. 2
STOT SE 3 |
| | 2 3 4 5 6-Pentafluorobenzylzinc chlorid& Usage And Synthesis |
| | 2 3 4 5 6-Pentafluorobenzylzinc chlorid& Preparation Products And Raw materials |
|