| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (R)-(+)-N-(TERT-BUTOXYCARBONYL)-O- Basic information |
| Product Name: | (R)-(+)-N-(TERT-BUTOXYCARBONYL)-O- | | Synonyms: | (R)-(+)-N-(TERT-BUTOXYCARBONYL)-O-;(R)-(+)-N-(TERT-BUTOXYCARBONYL)-O-(TERT-BUTYLDIMETHYLSILYL)SERIN;Carbamic acid, N-[(1R)-2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-1-(hydroxymethyl)ethyl]-, 1,1-dimethylethyl ester;ert-butylN-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropan-2-yl]carbamate;(R)-(+)-N-(TERT-BUTOXYCARBONYL)-O- USP/EP/BP;(R)-(+)-N-(tert-Butoxycarbonyl)-O-(tert-butyldimethylsilyl)serinol;tert-Butyl (r)-(1-((tert-Butyldimethylsilyl)oxy)-3-hydroxypropan-2-yl)carbamate;(R)-tert-Butyl (1-((tert-butyldimethylsilyl)oxy)-3-hydroxypropan-2-yl)carbamate | | CAS: | 152491-85-5 | | MF: | C14H31NO4Si | | MW: | 305.49 | | EINECS: | | | Product Categories: | Amino Acid Derivatives;Amino Alcohols;Peptide Synthesis | | Mol File: | 152491-85-5.mol |  |
| | (R)-(+)-N-(TERT-BUTOXYCARBONYL)-O- Chemical Properties |
| Melting point | 32-37 °C (lit.) | | Boiling point | 377.3±37.0 °C(Predicted) | | density | 0.979±0.06 g/cm3(Predicted) | | Fp | >230 °F | | pka | 11.57±0.46(Predicted) | | Optical Rotation | [α]20/D +17°, c = 1 in chloroform | | Major Application | peptide synthesis | | InChI | 1S/C14H31NO4Si/c1-13(2,3)19-12(17)15-11(9-16)10-18-20(7,8)14(4,5)6/h11,16H,9-10H2,1-8H3,(H,15,17)/t11-/m1/s1 | | InChIKey | OKOFEVZCVGPZCQ-LLVKDONJSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](CO)CO[Si](C)(C)C(C)(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (R)-(+)-N-(TERT-BUTOXYCARBONYL)-O- Usage And Synthesis |
| | (R)-(+)-N-(TERT-BUTOXYCARBONYL)-O- Preparation Products And Raw materials |
|