| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (R)-(+)-1-(1-Naphthyl)ethylamine hydrochloride Basic information |
| | (R)-(+)-1-(1-Naphthyl)ethylamine hydrochloride Chemical Properties |
| Melting point | 253-257 °C(lit.) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | Appearance | White to off-white Solid | | Optical Rotation | [α]/D 5.2±2°, c = 1 in methanol | | InChI | InChI=1/C12H13N.ClH/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11;/h2-9H,13H2,1H3;1H/t9-;/s3 | | InChIKey | ZTNKTVBJMXQOBQ-OVMXBOEKNA-N | | SMILES | C1(=CC=CC2C=CC=CC1=2)[C@@H](C)N.Cl |&1:10,r| |
| Hazard Codes | Xn,N | | Risk Statements | 22-36/37/38-50 | | Safety Statements | 26-60-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (R)-(+)-1-(1-Naphthyl)ethylamine hydrochloride Usage And Synthesis |
| Uses | (R)-(+)-1-(1-Naphthyl)ethylamine hydrochloride is a pharmaceutical intermediate used in the preparation of cinacalcet hydrochloride, which treats secondary hyperparathyroidism due to chronic kidney disease. In addition, (R)-(+)-1-(1-Naphthyl)ethylamine hydrochloride is also used in analytical assays. Absolute configuration of primary amines determined using chiral (2-nitrophenyl)proline amides and 1H NMR. |
| | (R)-(+)-1-(1-Naphthyl)ethylamine hydrochloride Preparation Products And Raw materials |
|