| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Anthrose Basic information |
| | Anthrose Chemical Properties |
| Melting point | 158-160°C | | Boiling point | 545.288±50.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.204±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | −20°C | | solubility | Methanol, Water | | form | Solid | | pka | 13.131±0.20(predicted) | | color | Off-White | | InChI | 1S/C11H21NO6/c1-5-7(8(14)9(15)10(16)18-5)12-6(13)4-11(2,3)17/h5,7-10,14-17H,4H2,1-3H3,(H,12,13)/t5-,7-,8+,9-,10/m1/s1 | | InChIKey | UUVASJJCLBEXCO-QNRYFBKSSA-N | | SMILES | C[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1NC(=O)CC(C)(C)O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Anthrose Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Anthrose, a nonreducing dideoxy-glucopyranose, has recently been identified as a unique component of the bacillus anthracis exosporium and Bacillus cereus endospores. Anthrose is used in anthrax research. | | Definition | ChEBI: Beta-anthropyranose is an amino monosaccharide consisting of D-glucose having a 3-hydroxy-3-methylbutanamido group at the 4-position, a 2-O-methyl group and lacking the 6-hydroxy group. |
| | Anthrose Preparation Products And Raw materials |
|