|
|
| | 3-Bromo-5-fluorobenzotrifluoride Basic information |
| | 3-Bromo-5-fluorobenzotrifluoride Chemical Properties |
| Boiling point | 138-139 °C (lit.) | | density | 1.511 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.456(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | Liquid or Low Melting Solid | | color | Colorless to yellow | | InChI | InChI=1S/C7H3BrF4/c8-5-1-4(7(10,11)12)2-6(9)3-5/h1-3H | | InChIKey | LIGBGEJPUQBLTG-UHFFFAOYSA-N | | SMILES | C1(Br)=CC(C(F)(F)F)=CC(F)=C1 | | CAS DataBase Reference | 130723-13-6(CAS DataBase Reference) |
| | 3-Bromo-5-fluorobenzotrifluoride Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liquid | | Uses | 3-Bromo-5-fluorobenzotrifluoride (1-Bromo-3-fluoro-5-(trifluoromethyl)benzene) may be used in the preparation of:
- 6-(3-fluoro-5-trifluoromethylphenyl)-hex-5-ynoic acid methyl ester
- (E)-5-[1-(3-fluoro-5-trifluoromethylphenyl)-5-methoxycarbonyl-pent-1-enyl]-2-methoxy-3-methylbenzoic acid methyl ester
- (E)-3-[4-(3-fluoro-5-trifluoromethylphenyl)-4-(3,4-dimethoxyphenyl)-but-3-enyl]-oxazolidin-2-one
- (E)-5-[1-(3-fluoro-5-trifluoromethylphenyl)-4-(2-oxo-oxazolidin-3-yl)-but-1-enyl]-2-methoxy-3-methylbenzoic acid methyl ester
|
| | 3-Bromo-5-fluorobenzotrifluoride Preparation Products And Raw materials |
|