Chelidonic acid monohydrate manufacturers
|
| | Chelidonic acid monohydrate Basic information | | Application |
| Product Name: | Chelidonic acid monohydrate | | Synonyms: | CHELIDONIC ACID MONOHYDRATE;4-OXO-4H-PYRAN-2,6-DICARBOXYLIC ACID MONOHYDRATE;CHELIDONIC ACID 1-HYDRATE;Chelidonic acid Monohydrate, 96% 25GR;Chelidonic acid Monohydrate, 96% 5GR;Chelidonic acid monohydrate,96%;4-oxo-4H-pyran-2,6-dicarboxylic acid hydrate;Chelidonic acid monohydrate, 2,6-Dicarboxy-4-oxo-4H-pyran monohydrate | | CAS: | 6003-94-7 | | MF: | C7H6O7 | | MW: | 202.12 | | EINECS: | | | Product Categories: | Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts | | Mol File: | 6003-94-7.mol |  |
| | Chelidonic acid monohydrate Chemical Properties |
| Melting point | 265 °C | | Water Solubility | very faint turbidity in hot Water | | form | Powder | | color | Light yellow to beige | | Merck | 14,2052 | | InChI | InChI=1S/C7H4O6.H2O/c8-3-1-4(6(9)10)13-5(2-3)7(11)12;/h1-2H,(H,9,10)(H,11,12);1H2 | | InChIKey | KJZJAKSEIQOKAK-UHFFFAOYSA-N | | SMILES | C(C1=CC(=O)C=C(C(=O)O)O1)(=O)O.O |
| Safety Statements | 24/25 | | RTECS | UP7350000 | | HS Code | 29329990 |
| Provider | Language |
|
ACROS
| English |
| | Chelidonic acid monohydrate Usage And Synthesis |
| Application | Chelidonic acid monohydrate is an intermediate in the synthesis of leucole. | | Chemical Properties | light yellow to beige powder |
| | Chelidonic acid monohydrate Preparation Products And Raw materials |
|