| Company Name: |
Suzhou Gold |
| Tel: |
18962320327 |
| Email: |
guiyuan@sc-iso.org |
|
| | Sodium carbonate-13C Chemical Properties |
| Melting point | 851 °C (lit.) | | form | powder | | InChI | InChI=1S/CH2O3.2Na/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2/i1+1;; | | InChIKey | CDBYLPFSWZWCQE-GOCMCNPZSA-L | | SMILES | [13C]([O-])([O-])=O.[Na+].[Na+] | | CAS Number Unlabeled | 497-19-8 |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36 | | Safety Statements | 22-26-36/37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Sodium carbonate-13C Usage And Synthesis |
| Preparation | Sodium carbonate-13C is typically synthesized from carbon dioxide or carbonates enriched with carbon-13 via chemical synthesis routes. For example, carbon-13 carbon dioxide is reacted with sodium hydroxide to produce sodium carbonate-13C. | | Uses | Sodium carbonate-13C is primarily used in scientific research and technological development. In chemical research, it serves as an isotope label to help trace chemical reaction pathways or study molecular dynamics. In environmental science, it can be used to analyze carbon cycle processes, such as simulating the absorption and release of carbon dioxide through labeling experiments. In industry, it is sometimes used as an internal standard to calibrate analytical instruments and ensure measurement accuracy. |
| | Sodium carbonate-13C Preparation Products And Raw materials |
|