|
|
| | 2,6-DIFLUORO-3-METHOXYBENZOIC ACID Basic information |
| | 2,6-DIFLUORO-3-METHOXYBENZOIC ACID Chemical Properties |
| Boiling point | 296.8±35.0 °C(Predicted) | | density | 1.399±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 2.22±0.10(Predicted) | | Appearance | White to yellow Solid | | Water Solubility | Insoluble in water. | | InChI | 1S/C8H6F2O3/c1-13-5-3-2-4(9)6(7(5)10)8(11)12/h2-3H,1H3,(H,11,12) | | InChIKey | YYZBRPSJLASNKL-UHFFFAOYSA-N | | SMILES | O=C(O)C1=C(F)C(OC)=CC=C1F |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2918999090 | | Storage Class | 11 - Combustible Solids |
| | 2,6-DIFLUORO-3-METHOXYBENZOIC ACID Usage And Synthesis |
| Uses | As pharmaceuticals, they find applications in antibiotics, as sedatives, and for cancer treatment. Used frequently in organic synthesis. Find application as propellants. |
| | 2,6-DIFLUORO-3-METHOXYBENZOIC ACID Preparation Products And Raw materials |
|