| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Dichloro(norbornadiene)palladium(II) Basic information | | Uses |
| Product Name: | Dichloro(norbornadiene)palladium(II) | | Synonyms: | DICHLORO(NORBORNADIENE)PALLADATE (II);DICHLORO(NORBORNADIENE)PALLADIUM (II);(BICYCLO[2.2.1]HEPTA-2,5-DIENE)DICHLOROPALLADIUM(II);(bicyclo(2.2.1)hepta-2,5-diene)dichloro-palladium;[(2,3,5,6-eta)-bicyclo[2.2.1]hepta-2,5-diene]dichloropalladium;Dichloro(norbornadiene)palladium(II),99%;Dichloro-(norbornadieno)-palladium;Palladium, [(2,3,5,6-h)-bicyclo[2.2.1]hepta-2,5-diene]dichloro- | | CAS: | 12317-46-3 | | MF: | C7H8Cl2Pd4* | | MW: | 269.46 | | EINECS: | 235-583-2 | | Product Categories: | Pd;organometallic complex;Catalysis and Inorganic Chemistry;Homogeneous Pd Catalysts;Palladium | | Mol File: | 12317-46-3.mol |  |
| | Dichloro(norbornadiene)palladium(II) Chemical Properties |
| Melting point | 260 °C (dec.)(lit.) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Powder | | color | yellow to orange | | InChI | 1S/C7H8.2ClH.Pd/c1-2-7-4-3-6(1)5-7;;;/h1-4,6-7H,5H2;2*1H;/q;;;+2/p-2 | | InChIKey | BNCRZJHZZCMDNP-UHFFFAOYSA-L | | SMILES | Cl[Pd]Cl.[CH]1[CH]C2[CH][CH]C1C2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-R36/37/38 | | Safety Statements | 26-37/39-S37/39-S26 | | WGK Germany | 3 | | HS Code | 2931.90.6000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Dichloro(norbornadiene)palladium(II) Usage And Synthesis |
| Uses | Dichloro(norbornadiene)palladium(II) can be useful starting material for the in situ preparation of a variety of chiral and achiral palladium catalysts.
| | Uses | Catalyst for:
- Aerobic kinetic resolution of secondary alcohols
- Kinetic oxidative resolution of 1-phenyl ethanol
- Oxidative kinetic resolution-Claisen rearrangement sequence
- Aerobic oxidation of secondary alcohols
| | reaction suitability | core: palladium
reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Cross Couplings
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst |
| | Dichloro(norbornadiene)palladium(II) Preparation Products And Raw materials |
|