|
|
| | 2,2,3,3,4,4,5,5-OCTAFLUORO-1,6-HEXANEDIOL Basic information |
| Product Name: | 2,2,3,3,4,4,5,5-OCTAFLUORO-1,6-HEXANEDIOL | | Synonyms: | 2,2,3,3,4,4,5,5-Octafluorohexane-1,6-diol 98%;2,2,3,3,4,4,5,5-Octafluorohexane-1,6-diol98%;2,2,3,3,4,4,5,5-OCTAFLUORO-1,6-HEXANEDIOL,99%;2,2,3,3,4,4,5,5-OCTAFLUORO-1,6-HEXANEDIOL 98%;1H,1H,6H,6H-Perfluorohexane-1,6-diol;(1E)-1-[(E)-3-phenylprop-2-enylidene]indene;1,6-DIHYDROXY-2,2,3,3,4,4,5,5-OCTAFLUOROHEXANE;2,2,3,3,4,4,5,5-OCTAFLUORO-1,6-HEXANEDIOL | | CAS: | 355-74-8 | | MF: | C6H6F8O2 | | MW: | 262.1 | | EINECS: | 670-345-5 | | Product Categories: | Fluorous Chemistry;Fluorous Compounds;Synthetic Organic Chemistry;Alcohols;Monomers;Polymer Science | | Mol File: | 355-74-8.mol |  |
| | 2,2,3,3,4,4,5,5-OCTAFLUORO-1,6-HEXANEDIOL Chemical Properties |
| Melting point | 66-70 °C(lit.) | | Boiling point | 100 °C3 mm Hg(lit.) | | density | 1.4712 (estimate) | | Fp | 100°C/3mm | | form | powder to crystal | | pka | 12.62±0.10(Predicted) | | color | White to Light yellow to Light orange | | Water Solubility | Soluble in water. | | BRN | 1784039 | | Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. | | InChI | InChI=1S/C6H6F8O2/c7-3(8,1-15)5(11,12)6(13,14)4(9,10)2-16/h15-16H,1-2H2 | | InChIKey | NHEKBXPLFJSSBZ-UHFFFAOYSA-N | | SMILES | C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CO | | CAS DataBase Reference | 355-74-8(CAS DataBase Reference) | | EPA Substance Registry System | 1H,1H,6H,6H-Perfluoro-1,6-hexanediol (355-74-8) |
| | 2,2,3,3,4,4,5,5-OCTAFLUORO-1,6-HEXANEDIOL Usage And Synthesis |
| Chemical Properties | white to off-white crystalline solid | | Uses | 2,2,3,3,4,4,5,5-Octafluoro-1,6-hexanediol is used as a pharmaceutical intermediate. |
| | 2,2,3,3,4,4,5,5-OCTAFLUORO-1,6-HEXANEDIOL Preparation Products And Raw materials |
|