| Company Name: |
Shangfluoro Gold |
| Tel: |
021-65170832 15601903708 |
| Email: |
qinba_2@163.com |
|
| | 1,4-Bis(2',3'-epoxypropyl)perfluorobutane Basic information |
| Product Name: | 1,4-Bis(2',3'-epoxypropyl)perfluorobutane | | Synonyms: | 2,2'-(2,2,3,3,4,4,5,5-Octafluorohexane-1,6-diyl)dioxirane 97%;2,2'-(2,2,3,3,4,4,5,5-Octafluorohexane-1,6-diyl)dioxirane97%;2,2'-(2,2,3,3,4,4,5,5-Octafluorohexane-1,6-diyl)bis(oxirane);1,4-BIS(EPOXYPROPYL)OCTAFLUOROBUTANE;1,4-BIS(2',3'-EPOXYPROPYL)OCTAFLUORO-N-BUTANE;1,4-BIS(2',3'-EPOXYPROPYL)PERFLUORO-1-BUTANE;1,4-BIS(2',3'-EPOXYPROPYL)-PERFLUORO-N-BUTANE;2,2'-(1H,1H,6H,6H-Perfluorohexane-1,6-diyl)dioxirane | | CAS: | 791-22-0 | | MF: | C10H10F8O2 | | MW: | 314.17 | | EINECS: | | | Product Categories: | | | Mol File: | 791-22-0.mol |  |
| | 1,4-Bis(2',3'-epoxypropyl)perfluorobutane Chemical Properties |
| Boiling point | 90/1.5mm | | density | 1.506 | | refractive index | 1.379 | | Fp | 133°C(lit.) | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C10H10F8O2/c11-7(12,1-5-3-19-5)9(15,16)10(17,18)8(13,14)2-6-4-20-6/h5-6H,1-4H2 | | InChIKey | KVSHGEMJMXSNTB-UHFFFAOYSA-N | | SMILES | C(C1CO1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC1CO1 |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2932990090 |
| | 1,4-Bis(2',3'-epoxypropyl)perfluorobutane Usage And Synthesis |
| | 1,4-Bis(2',3'-epoxypropyl)perfluorobutane Preparation Products And Raw materials |
|