| Company Name: |
Energy Chemical
|
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine rutheniuM(II) carbonyl CAS:41636-35-5 Package:100MG
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine ruthenium(II) carbonyl CAS:41636-35-5 Remarks:RA10540025
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine ruthenium(II) carbonyl CAS:41636-35-5 Purity:2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine ruthenium(II) Package:100MG Remarks:392456-100MG
|
|
| | 2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE RUTHENIUM(II) CARBONYL Basic information |
| Product Name: | 2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE RUTHENIUM(II) CARBONYL | | Synonyms: | 2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphine ru;octaethyl-21H,23H-porphine ruthenium(II) carbonyl;2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE RUTHENIUM(II) CARBONYL;2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine ruthenium(II) carbonyl | | CAS: | 41636-35-5 | | MF: | C37H44N4ORu | | MW: | 661.86 | | EINECS: | | | Product Categories: | Photonic and Optical Materials;Phthalocyanine and Porphyrin Dyes;PorphyrinesCatalysis and Inorganic Chemistry;Ru Catalysts;Ruthenium | | Mol File: | 41636-35-5.mol |  |
| | 2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE RUTHENIUM(II) CARBONYL Chemical Properties |
| λmax | 391 nm | | InChIKey | CRTFSNIGJRIMPF-YAJYDHHFSA-N | | SMILES | [C-]#[O+].CCc1c(CC)c2cc3c(CC)c(CC)c4cc5nc(cc6c(CC)c(CC)c(cc1n2)n6[Ru]n34)c(CC)c5CC |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE RUTHENIUM(II) CARBONYL Usage And Synthesis |
| Uses | 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine ruthenium(II) carbonyl (RuOEP )can form blended polymeric films with poly (3-hexythiopene-2,5-diyl)( P3HT). | | reaction suitability | reagent type: catalyst core: ruthenium |
| | 2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE RUTHENIUM(II) CARBONYL Preparation Products And Raw materials |
|