| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE Basic information |
| Product Name: | 2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE | | Synonyms: | 2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE;RARECHEM AS SA 0074;OCTAETHYLPORPHINE;21H,23H-Porphine, 2,3,7,8,12,13,17,18-octaethyl-;OCTAETHYLPORPHINE 97+% OEP;Octaethylporphineoep;2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE 97%;Octaethylpophine | | CAS: | 2683-82-1 | | MF: | C36H46N4 | | MW: | 534.78 | | EINECS: | 220-243-8 | | Product Categories: | organic building block;porphine (porphyrin) ligand;Biochemistry;MOFs COFs;Porphyrins;Synthetic Porphyrins | | Mol File: | 2683-82-1.mol |  |
| | 2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE Chemical Properties |
| Melting point | 322 °C | | Boiling point | 602.53°C (rough estimate) | | density | 1.063 | | refractive index | 1.7000 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | form | crystal | | pka | 26.58 (pKa1) | | color | purple | | λmax | 401 nm | | BRN | 379798 | | InChIKey | HCIIFBHDBOCSAF-MUZKIALCSA-N | | SMILES | C1=C2N=C(C=C3NC(=CC4=NC(=CC5NC1=C(CC)C=5CC)C(CC)=C4CC)C(CC)=C3CC)C(CC)=C2CC |c:0,4,7,11| | | EPA Substance Registry System | 21H,23H-Porphine, 2,3,7,8,12,13,17,18-octaethyl- (2683-82-1) |
| Safety Statements | 24/25-22 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ACROS
| English |
| | 2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE Usage And Synthesis |
| Chemical Properties | dark purple crystals or crystalline powder | | Uses | 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine (cas# 2683-82-1) porphyrin derivative, whose singlet and triplet energy transfer dynamics in axial porphyrin-anthracene complexes suggests it may play an important role in structures capable of photon upconversion. | | Definition | ChEBI: Octaethylporphyrin is a member of porphyrins. | | General Description | Metalated and metal free 2,3,7,8,12,13,17,18-octaethyl- 21H,23H-porphine (OEP) can form Langmuir Blodgett (LB) thin films. OEP has gas sensing properties.1 |
| | 2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE Preparation Products And Raw materials |
|