| Company Name: |
SUMMIT CHEMICAL Gold |
| Tel: |
020-82567763 13609796592 |
| Email: |
summitchem@163.com |
|
| | Diethylene glycol dimethacrylate Basic information |
| | Diethylene glycol dimethacrylate Chemical Properties |
| Melting point | >200℃/760mm | | Boiling point | 134 °C/2 mmHg (lit.) | | density | 1.082 g/mL at 25 °C (lit.) | | vapor pressure | 1.41Pa at 25℃ | | refractive index | n20/D 1.458(lit.) | | Fp | >230 °F | | storage temp. | -20°C | | solubility | Chloroform, Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Oil | | color | Clear Colourless | | Water Solubility | 581.5mg/L at 25℃ | | α-end | methacrylate | | Ω-end | methacrylate | | Henry's Law Constant | 1.2×104 mol/(m3Pa) at 25℃, HSDB (2015) | | Stability: | Light Sensitive | | Cosmetics Ingredients Functions | FILM FORMING NAIL CONDITIONING | | InChI | 1S/C12H18O5/c1-9(2)11(13)16-7-5-15-6-8-17-12(14)10(3)4/h1,3,5-8H2,2,4H3 | | InChIKey | XFCMNSHQOZQILR-UHFFFAOYSA-N | | SMILES | CC(=C)C(=O)OCCOCCOC(=O)C(C)=C | | LogP | 1.93 at 25℃ | | CAS DataBase Reference | 2358-84-1(CAS DataBase Reference) | | EPA Substance Registry System | Diethylene glycol dimethacrylate (2358-84-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-28 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 1 | | TSCA | TSCA listed | | HS Code | 29161400 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | | Hazardous Substances Data | 2358-84-1(Hazardous Substances Data) |
| | Diethylene glycol dimethacrylate Usage And Synthesis |
| Chemical Properties | Clear Colourless Oil | | Uses | Esters of acrylic acid and methacrylic acid, more commonly known as acrylates and methacrylates are key raw materials in the coatings and printing industry, and in food packaging. Dipropyleneglycol Dimethylacrylateis a resin compound for three-dimensional printing. It may also be used as a copolymer of crosslinkable monomers in electrochemical devices. | | Flammability and Explosibility | Non flammable | | reaction suitability | reagent type: cross-linking reagent reaction type: Polymerization Reactions |
| | Diethylene glycol dimethacrylate Preparation Products And Raw materials |
|