| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | L-Alanine-3,3,3-d3-N-t-Boc Basic information |
| Product Name: | L-Alanine-3,3,3-d3-N-t-Boc | | Synonyms: | L-ALANINE-N-T-BOC (3,3,3-D3);N-(TERT-BUTOXYCARBONYL)-L-ALANINE--3,3,3 ,-D3, 99 ATOM % D;boc-ala-oh-3,3,3-d3;N-(TERT-BUTOXYCARBONYL)-L-ALANINE-3,3,3-D3;N-(tert-Butoxycarbonyl)-L-alanine-3,3,3-d3, L-Alanine-3,3,3-d3, N-t-Boc derivative;L-Alanine-3,3,3-d3, N-t-Boc derivative;Boc-L-<3',3',3'-2H3>alanine;N-Boc-L-Alanine-D3 | | CAS: | 161602-47-7 | | MF: | C8H12D3NO4 | | MW: | 192.23 | | EINECS: | | | Product Categories: | Amino Acids 13C, 2H, 15N | | Mol File: | 161602-47-7.mol |  |
| | L-Alanine-3,3,3-d3-N-t-Boc Chemical Properties |
| Melting point | 79-83 °C(lit.) | | Boiling point | 320.912±25.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.127±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 4.019±0.10(predicted) | | form | solid | | Optical Rotation | [α]20/D 23°, c = 2 in acetic acid | | Major Application | peptide synthesis | | InChI | 1S/C8H15NO4/c1-5(6(10)11)9-7(12)13-8(2,3)4/h5H,1-4H3,(H,9,12)(H,10,11)/t5-/m0/s1/i1D3 | | InChIKey | QVHJQCGUWFKTSE-MQBGRFPLSA-N | | SMILES | [2H]C([2H])([2H])[C@H](NC(=O)OC(C)(C)C)C(O)=O | | CAS Number Unlabeled | 15761-38-3 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-Alanine-3,3,3-d3-N-t-Boc Usage And Synthesis |
| Uses | L-Alanine-3,3,3-d3-N-t-BOC acts as a reagent for the synthesis of amino acid derivatives that serves as precausors for peptides synthesis. |
| | L-Alanine-3,3,3-d3-N-t-Boc Preparation Products And Raw materials |
|