| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | DL-Alanine-3,3,3-d3 Basic information |
| Product Name: | DL-Alanine-3,3,3-d3 | | Synonyms: | 2-amino-3,3,3-trideuteriopropanoic acid;DL-ALANINE-3,3,3-D3, 99.5 ATOM % D;DL-Alanine-d3;DL-Alanine-3,3,3-d3 99 atom % D;DL-Alanine-3,3,3-d?;DL-Alanine-3,3,3-d3;DL-Alanine (3,3,3-D?, 98%);Dl-Alanine-3,3,3-D3 (Standard) | | CAS: | 53795-94-1 | | MF: | C3H4D3NO2 | | MW: | 92.11 | | EINECS: | | | Product Categories: | A;Alphabetical Listings;Stable Isotopes;Amino Acids 13C, 2H, 15N | | Mol File: | 53795-94-1.mol |  |
| | DL-Alanine-3,3,3-d3 Chemical Properties |
| Melting point | 289 °C (dec.) (lit.) | | Boiling point | 212.907±23.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.161±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 2.308±0.10(predicted) | | form | Solid | | color | White to off-white | | InChI | 1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/i1D3 | | InChIKey | QNAYBMKLOCPYGJ-FIBGUPNXSA-N | | SMILES | [2H]C([2H])([2H])C(N)C(O)=O | | CAS Number Unlabeled | 302-72-7 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | DL-Alanine-3,3,3-d3 Usage And Synthesis |
| Uses | DL-Alanine-d3 is the deuterium labeled DL-Alanine. DL-alanine, an amino acid, is the racemic compound of L- and D-alanine. DL-alanine is employed both as a reducing and a capping agent, used with silver nitrate aqueous solutions for the production of nanoparticles. DL-alanine can be used for the research of transition metals chelation, such as Cu(II), Zn(II), Cd(11). DL-alanine, a sweetener, is classed together with glycine, and sodium saccharin. DL-alanine plays a key role in the glucose-alanine cycle between tissues and liver[1][2][3][4][5][6]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110 |
| | DL-Alanine-3,3,3-d3 Preparation Products And Raw materials |
|