| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | NEURODYE RH-421 Basic information |
| Product Name: | NEURODYE RH-421 | | Synonyms: | NEURODYE RH-421;N-(4-SULFOBUTYL)-4-(4-(4-(DIPENTYLAMINO)PHENYL)BUTADIENYL) PYRIDINIUM, INNER SALT;RH 421;RH 421, INNER SALT;4-[4-[4-(DIPENTYLAMINO)PHENYL]-1,3-BUTADIENYL]-1-(4-SULFOBUTYL)PYRIDINIUM HYDROXIDE;RH 421 [N-(4-Sulfobutyl)-4-(4-(4- (dipentylamino)phenyl)butadienyl)pyridinium, inner salt] *CAS 107610-19-5*;NEURODYE RH-421, PURE;NEURODYE RH-421;4-{4-[4-(DIPENTYLAMINO)PHENYL]-1,3-BUTADIENYL}-1-(4-SULFOBUTYL)PYRIDINIUM HYDROXIDE | | CAS: | 107610-19-5 | | MF: | C29H42N2O3S | | MW: | 498.72 | | EINECS: | | | Product Categories: | Styryl | | Mol File: | 107610-19-5.mol |  |
| | NEURODYE RH-421 Chemical Properties |
| Melting point | >200℃ | | storage temp. | 2-8°C | | solubility | DMF: soluble | | form | powder | | color | red | | Appearance | Orange solid | | ex/em | 515/704 nm (MeOH) | | λmax | 515 nm | | Biological Applications | Measuring membrane potential | | InChIKey | URNCTMHGJQSLOC-UHFFFAOYSA-N | | SMILES | CCCCCN(CCCCC)c1ccc(\C=C\C=C/c2cc[n+](CCCCS([O-])(=O)=O)cc2)cc1 |
| Safety Statements | 24/25-22 | | WGK Germany | WGK 3 | | Storage Class | 13 - Non Combustible Solids |
| Provider | Language |
|
ACROS
| English |
| | NEURODYE RH-421 Usage And Synthesis |
| Chemical Properties | Appearance: Orange-red solid
ex/em: 515/704 nm (MeOH) | | Uses | RH 421 is a chromogenic substrate for β-galactosidase that forms magenta or red percipitate upon hydrolysis. Also suggested to be useful as a neuron-tracing dye monitoring neuronal activity. | | Biochem/physiol Actions | Chromogenic substrate for β-galactosidase that generates red or magenta precipitate on hydrolysis. |
| | NEURODYE RH-421 Preparation Products And Raw materials |
|