| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Diisobutyl disulfide Basic information |
| Product Name: | Diisobutyl disulfide | | Synonyms: | 1-(Isobutyldisulfanyl)-2-methylpropane;2,7-Dimethyl-4,5-dithiaoctane;Bis(2-methylpropyl) disulphide;Di(2-methylpropyl) disulfide;ISOBUTYL DISULFIDE;diisobutyl disulphide;Bis(2-methylpropyl) persulfide;Di(2-methylpropyl) persulfide | | CAS: | 1518-72-5 | | MF: | C8H18S2 | | MW: | 178.36 | | EINECS: | 216-177-4 | | Product Categories: | | | Mol File: | 1518-72-5.mol |  |
| | Diisobutyl disulfide Chemical Properties |
| Melting point | -36.74°C (estimate) | | Boiling point | 109 °C / 13mmHg | | density | 0,93 g/cm3 | | refractive index | 1.4840-1.4870 | | form | clear liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C8H18S2/c1-7(2)5-9-10-6-8(3)4/h7-8H,5-6H2,1-4H3 | | InChIKey | ONJROLGQWMBXAP-UHFFFAOYSA-N | | SMILES | S(CC(C)C)SCC(C)C | | LogP | 4.895 (est) | | CAS DataBase Reference | 1518-72-5(CAS DataBase Reference) |
| | Diisobutyl disulfide Usage And Synthesis |
| | Diisobutyl disulfide Preparation Products And Raw materials |
|