|
|
| | 3-(4-FLUORO-PHENYL)-PROPIONALDEHYDE Basic information |
| | 3-(4-FLUORO-PHENYL)-PROPIONALDEHYDE Chemical Properties |
| Boiling point | 208.7±15.0 °C(Predicted) | | density | 1.084±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | solid | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C9H9FO/c10-9-5-3-8(4-6-9)2-1-7-11/h3-7H,1-2H2 | | InChIKey | QZXPSIARJQTDNQ-UHFFFAOYSA-N | | SMILES | C1(CCC=O)=CC=C(F)C=C1 |
| WGK Germany | WGK 3 | | HS Code | 2912290090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 3-(4-FLUORO-PHENYL)-PROPIONALDEHYDE Usage And Synthesis |
| | 3-(4-FLUORO-PHENYL)-PROPIONALDEHYDE Preparation Products And Raw materials |
|