|
|
| | 6-Fluoro-2-methylindanone Basic information |
| Product Name: | 6-Fluoro-2-methylindanone | | Synonyms: | 6-FLUORO-2-METHYL-1-INDANONE;6-FLUORO-2-METHYLINDANONE;6-FLUORO-2-METHYL-2,3-DIHYDROINDEN-1-ONE;2-Methyl-6-fluoro-1-indanone;6-FLUORO-2-METHYL-2,3-DIHYDRO-1H-INDEN-1-ONE;2-METYL-6-FLUORO-1-INDANONE;6-Fluoro-2-methylindan-1-one;6-fluoro-2,3-dihydro-2-Methylinden-1-one | | CAS: | 37794-19-7 | | MF: | C10H9FO | | MW: | 164.18 | | EINECS: | 609-478-0 | | Product Categories: | PHARMACEUTICAL INTERMEDIATES | | Mol File: | 37794-19-7.mol |  |
| | 6-Fluoro-2-methylindanone Chemical Properties |
| Boiling point | 240.9±29.0 °C(Predicted) | | density | 1.179±0.06 g/cm3(Predicted) | | vapor pressure | 3.07Pa at 25℃ | | storage temp. | Sealed in dry,Room Temperature | | Water Solubility | 307.4mg/L at 25℃ | | InChI | InChI=1S/C10H9FO/c1-6-4-7-2-3-8(11)5-9(7)10(6)12/h2-3,5-6H,4H2,1H3 | | InChIKey | BABIQLUCYVRCIX-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC(F)=C2)CC1C | | LogP | 2.73 | | CAS DataBase Reference | 37794-19-7(CAS DataBase Reference) |
| HazardClass | IRRITANT | | HS Code | 2914790090 |
| | 6-Fluoro-2-methylindanone Usage And Synthesis |
| | 6-Fluoro-2-methylindanone Preparation Products And Raw materials |
|