| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Phenacyltriphenylphosphonium bromide Basic information |
| | Phenacyltriphenylphosphonium bromide Chemical Properties |
| Melting point | 265-268 °C (dec.) (lit.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | very faint turbidity in Methanol | | form | solid | | color | White to Light yellow to Light orange | | Sensitive | Hygroscopic | | BRN | 3642554 | | InChI | 1S/C26H22OP.BrH/c27-26(22-13-5-1-6-14-22)21-28(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;/h1-20H,21H2;1H/q+1;/p-1 | | InChIKey | AEHDSYHVTDJGDN-UHFFFAOYSA-M | | SMILES | [Br-].O=C(C[P+](c1ccccc1)(c2ccccc2)c3ccccc3)c4ccccc4 | | CAS DataBase Reference | 6048-29-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | TA2400000 | | HS Code | 29310099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Phenacyltriphenylphosphonium bromide Usage And Synthesis |
| Chemical Properties | LIGHT BEIGE AMORPHOUS POWDER | | Uses | Catalyst for protections and deprotection of alcohols via etherification
Reactant involved in:
- Investigations of gas-phase pyrolysis
- Asymmetric hydroxylamine / enone cascade reactions
- Reductive Michael cyclizations
- Microwave-assisted Wittig olefination
- Synthesis of polyfunctionally substituted heterocycles
| | reaction suitability | reaction type: C-C Bond Formation |
| | Phenacyltriphenylphosphonium bromide Preparation Products And Raw materials |
|