| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Triphenyl(propyl)phosphonium bromide Basic information |
| | Triphenyl(propyl)phosphonium bromide Chemical Properties |
| Melting point | 236-238 °C | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Sparingly, Heated), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Water Solubility | soluble | | Sensitive | Hygroscopic | | BRN | 3599726 | | Stability: | Hygroscopic | | InChI | InChI=1S/C21H22P.BrH/c1-2-18-22(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;/h3-17H,2,18H2,1H3;1H/q+1;/p-1 | | InChIKey | XMQSELBBYSAURN-UHFFFAOYSA-M | | SMILES | [P+](CCC)(C1C=CC=CC=1)(C1C=CC=CC=1)C1=CC=CC=C1.[Br-] | | CAS DataBase Reference | 6228-47-3(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-21/22 | | Safety Statements | 36/37-36/37/39-26 | | WGK Germany | 3 | | F | 3-8 | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Triphenyl(propyl)phosphonium bromide Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | n-Propyltriphenylphosphonium Bromide, is an analogue of phosphonium, acting as reversible inhibitors of cholinesterases of different animals. It has also been shown to be part of Phosphonium salts, having antiviral activity against influenza virus A. | | Uses | suzuki reaction | | reaction suitability | reaction type: C-C Bond Formation |
| | Triphenyl(propyl)phosphonium bromide Preparation Products And Raw materials |
|