| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 5-Sulfoisophthalic acid monolithium salt Basic information |
| | 5-Sulfoisophthalic acid monolithium salt Chemical Properties |
| Melting point | >300 °C(lit.) | | density | 0.757g/cm3 at 25℃ | | form | Solid:particulate/powder | | Odor | essential odorless | | InChI | 1S/C8H6O7S.Li/c9-7(10)4-1-5(8(11)12)3-6(2-4)16(13,14)15;/h1-3H,(H,9,10)(H,11,12)(H,13,14,15);/q;+1/p-1 | | InChIKey | GGKPBCOOXDBLLG-UHFFFAOYSA-M | | SMILES | [Li+].OC(=O)c1cc(cc(c1)S([O-])(=O)=O)C(O)=O | | LogP | -3.189 at 20℃ and pH7 | | EPA Substance Registry System | Monolithium 5-sulfoisophthalate (46728-75-0) |
| Hazard Codes | Xi | | Risk Statements | 41-38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29173995 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | 5-Sulfoisophthalic acid monolithium salt Usage And Synthesis |
| Chemical Properties | WHITE POWDER | | Uses | Monomer for water-dispersible polyesters. |
| | 5-Sulfoisophthalic acid monolithium salt Preparation Products And Raw materials |
|