|
|
| | Ethane-1,1,2,2-tetracarboxylic acid tetramethyl ester Basic information |
| Product Name: | Ethane-1,1,2,2-tetracarboxylic acid tetramethyl ester | | Synonyms: | AKOS 92220;tetramethyl ethane-1,1,2,2-tetracarboxylate;Ethane-1,1,2,2-tetracarboxylic acid tetramethyl;1,1,2,2-Ethanetetracarboxylic acid tetramethyl ester;2,2,3,3-Butanetetracarboxylic acid, 1,2,3,4-tetraMethyl ester;(2S)-4-(methylthio)-2-[[[[(2S)-4-(methylthio)-1-(4-nitrophenoxy)-1-oxobutan-2-yl]amino]-oxomethyl]amino]butanoic acid (4-nitrophenyl) ester;1,1,2,2-Tetramethyl ethane-1,1,2,2-tetracarboxylate;1,1,2,2-Ethanetetracarboxylic acid, 1,1,2,2-tetramethyl ester | | CAS: | 5464-22-2 | | MF: | C10H14O8 | | MW: | 262.21 | | EINECS: | 226-757-9 | | Product Categories: | | | Mol File: | 5464-22-2.mol |  |
| | Ethane-1,1,2,2-tetracarboxylic acid tetramethyl ester Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | InChI | InChI=1S/C10H16O8/c1-9(2,5(11)12,6(13)14)10(3,4,7(15)16)8(17)18/h1-4H3,(H,11,12)(H,13,14)(H,15,16)(H,17,18) | | InChIKey | GRZMCMAIZZALFT-UHFFFAOYSA-N | | SMILES | C(C)(C)(C(O)=O)(C(O)=O)C(C)(C)(C(O)=O)C(O)=O |
| | Ethane-1,1,2,2-tetracarboxylic acid tetramethyl ester Usage And Synthesis |
| Chemical Properties | White crystal or powder | | Synthesis Reference(s) | Organic Syntheses, Coll. Vol. 7, p. 482, 1990
Tetrahedron Letters, 30, p. 5583, 1989 DOI: 10.1016/S0040-4039(01)93805-5 |
| | Ethane-1,1,2,2-tetracarboxylic acid tetramethyl ester Preparation Products And Raw materials |
|