|
|
| | 6-Chloro-9-[3-(2-chloroethylamino)propylamino]-2-methoxyacridine dihydrochloride Basic information |
| Product Name: | 6-Chloro-9-[3-(2-chloroethylamino)propylamino]-2-methoxyacridine dihydrochloride | | Synonyms: | 2-methoxy-6-chloro-9-(3-(2-chloroethyl)aminopropylamino)acridine,dihydrochl;3-propanediamine,n-(2-chloroethyl)-n’-(6-chloro-2-methoxy-9-acridinyl)-d;3-propanediamine,n-(2-chloroethyl)-n’-(6-chloro-2-methoxy-9-acridinyl)-dih;6-chloro-9-(3-((2-chloroethyl)amino)propyl)amino-2-methoxy-acridindihydroc;icr-191a;icrdihydrochloride;ICR 191 ACRIDINE MUTAGEN;ICR 191 ACRIDINE MUTAGEN DIHYDROCHLORIDE | | CAS: | 17070-45-0 | | MF: | C19H22Cl3N3O | | MW: | 414.76 | | EINECS: | 241-129-4 | | Product Categories: | | | Mol File: | 17070-45-0.mol | ![6-Chloro-9-[3-(2-chloroethylamino)propylamino]-2-methoxyacridine dihydrochloride Structure](CAS/GIF/17070-45-0.gif) |
| | 6-Chloro-9-[3-(2-chloroethylamino)propylamino]-2-methoxyacridine dihydrochloride Chemical Properties |
| Melting point | 261-262 °C | | storage temp. | 2-8°C | | solubility | DMSO: soluble | | form | Solid | | color | Light Yellow to Yellow | | BRN | 8176205 | | InChI | 1S/C19H21Cl2N3O.2ClH/c1-25-14-4-6-17-16(12-14)19(23-9-2-8-22-10-7-20)15-5-3-13(21)11-18(15)24-17;;/h3-6,11-12,22H,2,7-10H2,1H3,(H,23,24);2*1H | | InChIKey | LMEMIKWTNPWYMI-UHFFFAOYSA-N | | SMILES | Cl[H].Cl[H].COc1ccc2nc3cc(Cl)ccc3c(NCCCNCCCl)c2c1 | | EPA Substance Registry System | 2-Methoxy-6-chloro-9-(2-chloroethylaminopropylamino)acridine dihydrochloride (17070-45-0) |
| Hazard Codes | T+ | | Risk Statements | 45-46-26/27/28 | | Safety Statements | 53-36/37/39-45 | | RIDADR | UN 2811 6.1/PG 1 | | WGK Germany | 3 | | RTECS | AR7678000 | | F | 8 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 2 Dermal Acute Tox. 2 Oral Carc. 1B |
| | 6-Chloro-9-[3-(2-chloroethylamino)propylamino]-2-methoxyacridine dihydrochloride Usage And Synthesis |
| Chemical Properties | yellow crystals or powder | | Uses | Acridine Mutagen ICR 191 is a probe used in the Ames test usingSalmonella and E. coli. | | Definition | ChEBI: A hydrochloride salt resulting from the reaction of acridine half-mustard with 2 mol eq. of hydrogen chloride. | | General Description | Yellow crystalline or chunky solid. | | Air & Water Reactions | May be sensitive to air. . | | Reactivity Profile | 6-CHLORO-9-[3-(2-CHLOROETHYLAMINO)PROPYLAMINO]-2-METHOXYACRIDINE DIHYDROCHLORIDE reacts as a weak acid. | | Fire Hazard | Flash point data for 6-CHLORO-9-[3-(2-CHLOROETHYLAMINO)PROPYLAMINO]-2-METHOXYACRIDINE DIHYDROCHLORIDE are not available. 6-CHLORO-9-[3-(2-CHLOROETHYLAMINO)PROPYLAMINO]-2-METHOXYACRIDINE DIHYDROCHLORIDE is probably combustible. |
| | 6-Chloro-9-[3-(2-chloroethylamino)propylamino]-2-methoxyacridine dihydrochloride Preparation Products And Raw materials |
|