|
|
| | 9-Amino-6-chloro-2-methoxyacridine Basic information |
| | 9-Amino-6-chloro-2-methoxyacridine Chemical Properties |
| Melting point | >250°C | | Boiling point | 475.1±35.0 °C(Predicted) | | density | 1.367±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | Solubility Insoluble in water; soluble in N, N-dimethylformamide, dimethyl sulfoxide | | form | Solid | | pka | 8.6(at 25℃) | | color | Yellow | | PH Range | Weak blue B uorescence (7.5) to strong blue B uorescence (9.8) | | Appearance | Solid Powder | | λmax | 412nm | | Biological Applications | Antimalarial; bactericidal; detection of cancer cells,nucleic acids; treating malformed proteins causing neurodegenerative disease | | Major Application | Sensors, detection method for DNA amplification, inhibition of neurode-generative diseases, RNA hydrolysis, fluorescent probes, primers for nucleic acid sequencing, synthesis of nucleic acids, antimalerial agent | | SMILES | ClC(C=CC1=C2N)=CC1=NC3=C2C=C(OC)C=C3 |
| | 9-Amino-6-chloro-2-methoxyacridine Usage And Synthesis |
| Description | 9-Amino-6-chloro-2-methoxyacridine (ACMA) is a cell-permeable fluorescent probe for labeling DNA with selectivity for poly(dA-dT) sequences. ACMA fluorescence is quenched when a pH gradient is established, a property that has been utilized in animal- and plant-based studies. It also inhibits acetylcholinesterase with a Ki value of 49 nM. | | Uses | 9-Amino-6-chloro-2-methoxyacridine is a nucleic acid stain. | | Excitation / Emission Maximum | 411 nm/475 nm |
| | 9-Amino-6-chloro-2-methoxyacridine Preparation Products And Raw materials |
|