| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-BROMO-4,5-DIFLUOROBENZOIC ACID Basic information |
| Product Name: | 2-BROMO-4,5-DIFLUOROBENZOIC ACID | | Synonyms: | 2-BROMO-4,5-DIFLUOROBENZOIC ACID;Benzoic acid,2-broMo-4,5-difluoro-;2-Bromo-4,5-difluorobenzoic acid,97%;2-Bromo-4,5-difluorobenzoicaci;2-Bromo-4,5-difluorobenzoic acid,98%min, | | CAS: | 64695-84-7 | | MF: | C7H3BrF2O2 | | MW: | 237 | | EINECS: | | | Product Categories: | Fluorine series;Benzoic acid;Carboxylic Acids;Carbonyl Compounds;C7 | | Mol File: | 64695-84-7.mol |  |
| | 2-BROMO-4,5-DIFLUOROBENZOIC ACID Chemical Properties |
| Melting point | 118-122 °C (lit.) | | Boiling point | 291.3±40.0 °C(Predicted) | | density | 1.872±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | pka | 2.45±0.10(Predicted) | | form | Crystalline Powder | | color | White to yellow | | InChI | InChI=1S/C7H3BrF2O2/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2H,(H,11,12) | | InChIKey | DGCBGBZYTNTZJH-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(F)=C(F)C=C1Br | | CAS DataBase Reference | 64695-84-7(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22 | | Safety Statements | 36-24/25 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-BROMO-4,5-DIFLUOROBENZOIC ACID Usage And Synthesis |
| Chemical Properties | White to yellow crystalline powder | | Uses | 2-Bromo-4,5-difluorobenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | | Synthesis | The synthesis of 2-bromo-4, 5-difluorobenzoic acid was achieved from difluorophthalic anhydride by either using a Losen rearrangement or the Barton bromodecarboxylation reaction. |
| | 2-BROMO-4,5-DIFLUOROBENZOIC ACID Preparation Products And Raw materials |
|