|
|
| | 3-Amino-5-hydroxypyrazole Basic information |
| | 3-Amino-5-hydroxypyrazole Chemical Properties |
| Melting point | 214 °C (dec.) (lit.) | | Boiling point | 185.55°C (rough estimate) | | density | 1.3131 (rough estimate) | | refractive index | 1.4500 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) | | form | Crystalline Powder | | pka | 12.37±0.40(Predicted) | | color | Yellow-beige to beige-brown | | BRN | 507793 | | InChI | InChI=1S/C3H5N3O/c4-2-1-3(7)6-5-2/h1H2,(H2,4,5)(H,6,7) | | InChIKey | QZBGOTVBHYKUDS-UHFFFAOYSA-N | | SMILES | N1=C(N)CC(=O)N1 | | CAS DataBase Reference | 6126-22-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29331990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-Amino-5-hydroxypyrazole Usage And Synthesis |
| Chemical Properties | yellow-beige to beige-brown crystalline powder | | Uses | Amino-substituted heterocyclic compound with moderate alanine racemase inhibitory activity. | | Uses | 3-Amino-5-hydroxypyrazole was used in the synthesis of 2,6-difluoro-N-(3-methoxy-1H-pyrazolo[3,4-b]pyridine-5-yl)-3-(propylsulfonamidio)benzamide and heteroaromatic 3-hydroxy-5,6-diphenylpyrazolo[3,4-b]pyridines. | | General Description | Molecular and vibrational structure of 3-amino-5-hydroxypyrazole was investigated by density functional method. |
| | 3-Amino-5-hydroxypyrazole Preparation Products And Raw materials |
|