Trifluoroacetyl Tripeptide-2 manufacturers
- Tripeptide-2
-
- $33.00
-
2026-07-19
- CAS:64577-63-5
- Min. Order: 1kg
- Purity: 99
- Supply Ability: 1000kg
|
| | Trifluoroacetyl Tripeptide-2 Basic information |
| Product Name: | Trifluoroacetyl Tripeptide-2 | | Synonyms: | TFA-VAL-TYR-VAL-OH;ECM-Protect;Trifluoroacetyl Tripeptide-2, Progeline;L-Valine,N-(2,2,2-trifluoroacetyl)-L-valyl-L-tyrosyl-;N-(2,2,2-Trifluoroacetyl)-L-valyl-L-tyrosyl-L-valine;Trifluoroacetyl Tripeptide-2Q: What is
Trifluoroacetyl Tripeptide-2 Q: What is the CAS Number of
Trifluoroacetyl Tripeptide-2;Peptide Progeline Trifluoroacetyl Tripeptide 2;Triuoroacetyl Tripeptide-2 | | CAS: | 64577-63-5 | | MF: | C21H28F3N3O6 | | MW: | 475.46 | | EINECS: | 000-000-0 | | Product Categories: | | | Mol File: | 64577-63-5.mol |  |
| | Trifluoroacetyl Tripeptide-2 Chemical Properties |
| Boiling point | 755.4±60.0 °C(Predicted) | | density | 1.299±0.06 g/cm3(Predicted) | | storage temp. | -15°C | | form | Solid | | pka | 3.32±0.10(Predicted) | | color | White to off-white | | Sequence | {Tfa}-Val-Tyr-Val | | Cosmetics Ingredients Functions | SKIN CONDITIONING
SKIN PROTECTING | | InChIKey | SAVSLMGBKQKUAV-JYJNAYRXSA-N | | SMILES | C(O)(=O)[C@H](C(C)C)NC(=O)[C@H](CC1=CC=C(O)C=C1)NC(=O)[C@H](C(C)C)NC(C(F)(F)F)=O |
| | Trifluoroacetyl Tripeptide-2 Usage And Synthesis |
| Chemical Properties | Trifluoroacetyl Tripeptide-2 is an active tripeptide derived from elastase inhibitor. It has excellent emulsifying, dispersing, antistatic, spreading, and wetting abilities, avoiding residual substances that are naturally harmful to the skin. The damage of the protective layer can be used for a long time. | | Uses | Trifluoroacetyl Tripeptide-2 is an active tripeptide derived from elastase inhibitor, which can reduce the synthesis of progeria protein and improve skin laxity, sagging and wrinkles caused by it, It also improves skin firmness, elasticity and facial contours. | | Mechanism of action | The mechanism of action of trifluoroacetyl tripeptide-2 is as follows: ◆Regulates the production of progerin: protects the nuclear lamina, prolongs cell life, and delays cell senescence; ◆ Increase longevity protein: stimulate the production of longevity protein; ◆ Increase collagen: restore collagen to young cell level; ◆ Inhibit elastase activity: reduce elastin degradation, promote Skin is firmer and more elastic. |
| | Trifluoroacetyl Tripeptide-2 Preparation Products And Raw materials |
|