| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4,4-(Dimethylcyclohex-2-enone)-2-boronic acid, pinacol ester Basic information |
| Product Name: | 4,4-(Dimethylcyclohex-2-enone)-2-boronic acid, pinacol ester | | Synonyms: | 4,4-Dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-enone;3,3-Dimethyl-6-oxocyclohex-1-ene-1-boronic acid, pinacol ester;4,4-Dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-en-1-one, 2-(3,3-Dimethyl-6-oxocyclohex-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;4,4-DiMethyl-2-cyclohexen-1-one-2-boronic acid pinacol ester, 97%;4,4-Dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-en-1-one;2-Cyclohexen-1-one, 4,4-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;4,4-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)...;4,4-Dimethyl-2-cyclohexen-1-one-2-boronic acid pinacol ester, 97%, | | CAS: | 219489-09-5 | | MF: | C14H23BO3 | | MW: | 250.14 | | EINECS: | 691-595-1 | | Product Categories: | Heterocyclic Compounds | | Mol File: | 219489-09-5.mol |  |
| | 4,4-(Dimethylcyclohex-2-enone)-2-boronic acid, pinacol ester Chemical Properties |
| Boiling point | 295.8±50.0 °C(Predicted) | | density | 1.00±0.1 g/cm3(Predicted) | | form | solid | | color | White | | InChI | 1S/C14H23BO3/c1-12(2)8-7-11(16)10(9-12)15-17-13(3,4)14(5,6)18-15/h9H,7-8H2,1-6H3 | | InChIKey | MMYLPQABFZSMCP-UHFFFAOYSA-N | | SMILES | B2(OC(C(O2)(C)C)(C)C)C1=CC(CCC1=O)(C)C |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4,4-(Dimethylcyclohex-2-enone)-2-boronic acid, pinacol ester Usage And Synthesis |
| | 4,4-(Dimethylcyclohex-2-enone)-2-boronic acid, pinacol ester Preparation Products And Raw materials |
|