| Company Name: |
S.Z. PhyStandard Bio-Tech. Co., Ltd.
|
| Tel: |
0755-4000505016 13380397412 |
| Email: |
3001272453@qq.com |
| Products Intro: |
Product Name:Upadacitinib Impurity 71 Purity:98%HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Amel Pharmatech Corporation
|
| Tel: |
027-888-4366503 |
| Email: |
sales@amelpharmatech.com |
| Products Intro: |
Product Name:1-Pyrrolidinecarboxylic acid, 3-acetyl-4-ethyl-, phenylmethyl ester, (3R,4S)- CAS:2411540-29-7 Purity:98% Package:g; kg
|
1-Pyrrolidinecarboxylic acid, 3-acetyl-4-ethyl-, phenylmethyl ester, (3R,4S)- manufacturers
|
| | 1-Pyrrolidinecarboxylic acid, 3-acetyl-4-ethyl-, phenylmethyl ester, (3R,4S)- Basic information |
| Product Name: | 1-Pyrrolidinecarboxylic acid, 3-acetyl-4-ethyl-, phenylmethyl ester, (3R,4S)- | | Synonyms: | 1-Pyrrolidinecarboxylic acid, 3-acetyl-4-ethyl-, phenylmethyl ester, (3R,4S)-;(3R,4S)-benzyl 3-acetyl-4-ethylpyrrolidine-1-carboxylate;Upadacitinib Impurity 93;Upadacitinib Impurity 71;Upatinib Impurity 93;(3S,4R)-benzyl 3-ethyl-4-(2,2,2-tribromoacetyl)pyrrolidine-1-carboxylate;(3R, 4S) -3-acetyl-4-ethyl-1-pyrrolidinecarboxylic acid benzyl ester;Phenylmethyl (3R,4S)-3-acetyl-4-ethyl-1-pyrrolidinecarboxylate | | CAS: | 2411540-29-7 | | MF: | C16H21NO3 | | MW: | 275.34 | | EINECS: | | | Product Categories: | | | Mol File: | 2411540-29-7.mol |  |
| | 1-Pyrrolidinecarboxylic acid, 3-acetyl-4-ethyl-, phenylmethyl ester, (3R,4S)- Chemical Properties |
| Boiling point | 401.7±45.0 °C(Predicted) | | density | 1.115±0.06 g/cm3(Predicted) | | pka | -2.58±0.60(Predicted) | | InChI | InChI=1S/C16H21NO3/c1-3-14-9-17(10-15(14)12(2)18)16(19)20-11-13-7-5-4-6-8-13/h4-8,14-15H,3,9-11H2,1-2H3/t14-,15-/m1/s1 | | InChIKey | IDAIPNZJYAVREK-HUUCEWRRSA-N | | SMILES | N1(C(OCC2=CC=CC=C2)=O)C[C@@H](CC)[C@@H](C(C)=O)C1 |
| | 1-Pyrrolidinecarboxylic acid, 3-acetyl-4-ethyl-, phenylmethyl ester, (3R,4S)- Usage And Synthesis |
| Description | 1-Pyrrolidinecarboxylic acid, 3-acetyl-4-ethyl-, phenylmethyl ester, (3R,4S)- is an intermediate for upadacitinib. Upadacitinib is a potent and highly selective JAK1 inhibitor that has been approved by the FDA for the treatment of rheumatoid arthritis. |
| | 1-Pyrrolidinecarboxylic acid, 3-acetyl-4-ethyl-, phenylmethyl ester, (3R,4S)- Preparation Products And Raw materials |
|