|
|
| | 1,1,1,3,3,3-Hexafluoro-2-((4-propylamino)phenyl)propan-2-ol Basic information |
| Product Name: | 1,1,1,3,3,3-Hexafluoro-2-((4-propylamino)phenyl)propan-2-ol | | Synonyms: | Benzenemethanol, 4-(propylamino)-α,α-bis(trifluoromethyl)-;1,1,1,3,3,3-Hexafluoro-2-((4-propylamino)phenyl)propan-2-ol | | CAS: | 874479-45-5 | | MF: | C12H13F6NO | | MW: | 301.23 | | EINECS: | | | Product Categories: | | | Mol File: | 874479-45-5.mol |  |
| | 1,1,1,3,3,3-Hexafluoro-2-((4-propylamino)phenyl)propan-2-ol Chemical Properties |
| Boiling point | 324.3±42.0 °C(Predicted) | | density | 1.354±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 9.77±0.15(Predicted) | | InChI | 1S/C12H13F6NO/c1-2-7-19-9-5-3-8(4-6-9)10(20,11(13,14)15)12(16,17)18/h3-6,19-20H,2,7H2,1H3 | | InChIKey | CGPTXLPKLSGZHK-UHFFFAOYSA-N | | SMILES | FC(F)(C(C(F)(F)F)(C1=CC=C(NCCC)C=C1)O)F |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | 1,1,1,3,3,3-Hexafluoro-2-((4-propylamino)phenyl)propan-2-ol Usage And Synthesis |
| | 1,1,1,3,3,3-Hexafluoro-2-((4-propylamino)phenyl)propan-2-ol Preparation Products And Raw materials |
|