|
|
| | 4-methyl-2-pyrid-4-yl-1,3-thiazole-5-carboxylic acid Basic information |
| | 4-methyl-2-pyrid-4-yl-1,3-thiazole-5-carboxylic acid Chemical Properties |
| Melting point | 290-313 °C | | Boiling point | 467℃ | | density | 1.381 | | Fp | 236℃ | | storage temp. | 2-8°C | | solubility | DMF: 2.5 mg/ml; DMSO: 2.5 mg/ml; DMSO:PBS(pH7.2) 1:1: 0.5 mg/ml | | form | A crystalline solid | | pka | 1.71±0.37(Predicted) | | InChI | 1S/C10H8N2O2S/c1-6-8(10(13)14)15-9(12-6)7-2-4-11-5-3-7/h2-5H,1H3,(H,13,14) | | InChIKey | WAIPVXWDQQHMQG-UHFFFAOYSA-N | | SMILES | Cc1nc(sc1C(O)=O)-c2ccncc2 |
| Hazard Codes | Xi | | Risk Statements | 36-36/37/38-22 | | Safety Statements | 26-36/37/39-22 | | WGK Germany | 3 | | Hazard Note | Harmful | | HazardClass | IRRITANT | | HS Code | 2934100090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 4-methyl-2-pyrid-4-yl-1,3-thiazole-5-carboxylic acid Usage And Synthesis |
| Uses | 2-(4-Pyridyl)-4-methyl-thiazole-5-carboxylic acid (4-Methyl-2-pyridin-4-ylthiazole-5-carboxylic acid) is a synthetic intermediate useful for pharmaceutical synthesis. |
| | 4-methyl-2-pyrid-4-yl-1,3-thiazole-5-carboxylic acid Preparation Products And Raw materials |
|