1-methylpyrrolidin-3-yl cyclopentylphenylglycolate manufacturers
|
| | 1-methylpyrrolidin-3-yl cyclopentylphenylglycolate Basic information |
| Product Name: | 1-methylpyrrolidin-3-yl cyclopentylphenylglycolate | | Synonyms: | 1-Methylpyrrolidin-3-yl -2-cyclopentylhydroxyphenylacetate;α-Cyclopentyl-α-hydroxybenzeneacetic acid 1-methylpyrrolidin-3-yl ester;Glycopyrrolate Related Compound B (75 mg) (1-Methylpyrrolidin-3-yl 2-cyclopentyl-2-hydroxy-2-phenylacetate);N-Methyl-3-pyrrolidinyl CyclopentylMandelate (Mixture of diastereoMers);1-Methylpyrrolidin-3-yl 2-cyclopentyl-2-hydroxy-2-phenylacetate;1-methylpyrrolidin-3-yl cyclopentylphenylglycolate;N-Methyl-3-pyrrolidinyl Cyclopentylmandelate;α-Cyclopentyl-mandelic Acid 1-Methyl-3-pyrrolidinyl Ester | | CAS: | 13118-11-1 | | MF: | C18H25NO3 | | MW: | 303.4 | | EINECS: | 236-047-0 | | Product Categories: | Aromatics;Heterocycles;Aromatics Compounds | | Mol File: | 13118-11-1.mol |  |
| | 1-methylpyrrolidin-3-yl cyclopentylphenylglycolate Chemical Properties |
| Boiling point | 434.6±45.0 °C(Predicted) | | density | 1.17±0.1 g/cm3 (20 ºC 760 Torr) | | refractive index | 1.5256 (589.3 nm 23℃) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Oil | | pka | 12.19±0.29(Predicted) | | color | Colourless to Very Dark Orange | | Major Application | pharmaceutical | | InChI | InChI=1S/C18H25NO3/c1-19-12-11-16(13-19)22-17(20)18(21,15-9-5-6-10-15)14-7-3-2-4-8-14/h2-4,7-8,15-16,21H,5-6,9-13H2,1H3 | | InChIKey | OVGMKPGXRHJNKJ-UHFFFAOYSA-N | | SMILES | C1(CCN(C1)C)OC(=O)C(O)(C1C=CC=CC=1)C1CCCC1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1-methylpyrrolidin-3-yl cyclopentylphenylglycolate Usage And Synthesis |
| Chemical Properties | Light-Yellow Oil | | Uses | Glycopyrrolate impurity. |
| | 1-methylpyrrolidin-3-yl cyclopentylphenylglycolate Preparation Products And Raw materials |
|