|
|
| | LPHE-009 Basic information |
| Product Name: | LPHE-009 | | Synonyms: | Glycopyrrolate Impurity 19;Benzeneacetic acid, α-cyclopentyl-α-hydroxy-, (αR)-;(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetic acid;LPHE-009;(R)-alpha-Cyclop;Benzeneaceticacid,α-cyclopentyl-αChemicalbook-hydroxy-,(αR)-;(R)-a-cyclopentylmandelic acid;(R)-2-cyclopentyl-2-hydroxy-2-phenylace | | CAS: | 64471-45-0 | | MF: | C13H16O3 | | MW: | 220.27 | | EINECS: | | | Product Categories: | | | Mol File: | 64471-45-0.mol |  |
| | LPHE-009 Chemical Properties |
| Melting point | 121-122 °C | | Boiling point | 395.6±22.0 °C(Predicted) | | density | 1.247±0.06 g/cm3(Predicted) | | pka | 3.53±0.25(Predicted) | | InChI | InChI=1/C13H16O3/c14-12(15)13(16,11-8-4-5-9-11)10-6-2-1-3-7-10/h1-3,6-7,11,16H,4-5,8-9H2,(H,14,15)/t13-/s3 | | InChIKey | WFLUEQCOAQCQLP-VHLFKADZNA-N | | SMILES | [C@](C1CCCC1)(C1C=CC=CC=1)(O)C(=O)O |&1:0,r| |
| | LPHE-009 Usage And Synthesis |
| Uses | (R)-α-Cyclopentylmandelic Acid is used in chiral ligand exchange high-speed countercurrent chromatography and application in enantioseparation of aromatic α-hydroxyl acids. |
| | LPHE-009 Preparation Products And Raw materials |
|