| Company Name: |
Bide Pharmatech Ltd. Gold |
| Tel: |
400-164-7117 18317119277 |
| Email: |
product02@bidepharm.com |
|
| | 2,4(1H,3H)-Pyrimidinedione, dihydro-3-[(4-methoxyphenyl)methyl]- Basic information |
| Product Name: | 2,4(1H,3H)-Pyrimidinedione, dihydro-3-[(4-methoxyphenyl)methyl]- | | Synonyms: | 2,4(1H,3H)-Pyrimidinedione, dihydro-3-[(4-methoxyphenyl)methyl]-;3-[(4-methoxyphenyl)methyl]hexahydropyrimidine-2,4-dione;3-(4-Methoxybenzyl)dihydropyrimidine-2,4(1H,3H)-dione;Dihydro-3-[(4-methoxyphenyl)methyl]-2,4(1H,3H)-pyrimidinedione | | CAS: | 2631060-00-7 | | MF: | C12H14N2O3 | | MW: | 234.25 | | EINECS: | | | Product Categories: | | | Mol File: | 2631060-00-7.mol | ![2,4(1H,3H)-Pyrimidinedione, dihydro-3-[(4-methoxyphenyl)methyl]- Structure](CAS/20210305/GIF/2631060-00-7.gif) |
| | 2,4(1H,3H)-Pyrimidinedione, dihydro-3-[(4-methoxyphenyl)methyl]- Chemical Properties |
| density | 1.240±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 12.17±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C12H14N2O3/c1-17-10-4-2-9(3-5-10)8-14-11(15)6-7-13-12(14)16/h2-5H,6-8H2,1H3,(H,13,16) | | InChIKey | NBYPMKOCGYFYFO-UHFFFAOYSA-N | | SMILES | C1(=O)NCCC(=O)N1CC1=CC=C(OC)C=C1 |
| | 2,4(1H,3H)-Pyrimidinedione, dihydro-3-[(4-methoxyphenyl)methyl]- Usage And Synthesis |
| | 2,4(1H,3H)-Pyrimidinedione, dihydro-3-[(4-methoxyphenyl)methyl]- Preparation Products And Raw materials |
|