| Company Name: |
DebyeTec.com Inc. |
| Tel: |
18086626237 18086626237 |
| Email: |
2693528373@qq.com |
|
| | 2-octyldecanoic acid Basic information |
| Product Name: | 2-octyldecanoic acid | | Synonyms: | 2-octyldecanoic acid;Dioctylacetic acid;2-octylcapric acid;Decanoic acid, 2-octyl-;EINECS 210-594-5;2-Octydecanoic acid | | CAS: | 619-39-6 | | MF: | C18H36O2 | | MW: | 284.48 | | EINECS: | 2105945 | | Product Categories: | | | Mol File: | 619-39-6.mol |  |
| | 2-octyldecanoic acid Chemical Properties |
| Melting point | 38.5°C | | Boiling point | 369.53°C (estimate) | | density | 0.8833 (rough estimate) | | refractive index | 1.4430 (estimate) | | pka | 4.82±0.40(Predicted) | | form | <38.5°C Solid,>38.5°C Liquid | | InChI | InChI=1S/C18H36O2/c1-3-5-7-9-11-13-15-17(18(19)20)16-14-12-10-8-6-4-2/h17H,3-16H2,1-2H3,(H,19,20) | | InChIKey | OYYXZGFIZTYYRB-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(CCCCCCCC)CCCCCCCC | | LogP | 7.674 (est) | | EPA Substance Registry System | Decanoic acid, 2-octyl- (619-39-6) |
| | 2-octyldecanoic acid Usage And Synthesis |
| Uses | 2-Octyldecanoic acid (Octyldecanoic acid) is a saturated fatty acid with a long aliphatic tail consisting of 17 carbon atoms and a carboxylic acid group. |
| | 2-octyldecanoic acid Preparation Products And Raw materials |
|