| Company Name: |
Sichuan Wei Keqi Biological Technology Co., Ltd.
|
| Tel: |
028-81700200 18116577057 |
| Email: |
3003855609@qq.com |
| Products Intro: |
Product Name:Cucurbitacin E-2-O-glucoside
CAS:1398-78-3
Purity:HPLC>=98% Package:5mg;10mg;20mg;50mg;100mg;200mg;500mg;1g
|
| Company Name: |
Wuhan ChemFaces Biochemical Co., Ltd.
|
| Tel: |
18607101326 15172504745 |
| Email: |
aileen@chemfaces.com |
| Products Intro: |
Product Name:Cucurbitacin E-2-O-beta-D-glucopyranoside
CAS:1398-78-3
Purity:>=98% Package:5mg ,10mg ,20mg ,50mg ,100mg; 200mg; 500mg,可根据客户需求定制 Remarks:2478/5mg
|
|
| | colocynthin Basic information |
| Product Name: | colocynthin | | Synonyms: | colocynthin;Cocillana;(10α)-25-(Acetyloxy)-2-(β-D-glucopyranosyloxy)-16α,20-dihydroxy-9β-methyl-19-norlanosta-1,5,23-triene-3,11,22-trione;2-O-β-D-Glucopyranosylcucurbitacin E;Coloside A;α-Elaterin 2-D-glucopyranoside;Cucurbitacin E-2-O-Glucoside;alpha-Elaterin 2-D-glucopyranoside | | CAS: | 1398-78-3 | | MF: | C38H54O13 | | MW: | 718.83 | | EINECS: | 215-745-9 | | Product Categories: | Organics | | Mol File: | 1398-78-3.mol |  |
| | colocynthin Chemical Properties |
| Melting point | 158-160℃ | | alpha | D +50° (c = 0.4 in ethanol) | | density | 1.35±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | -20°C | | form | solid | | Major Application | food and beverages | | InChIKey | QKEJRKXVLGOJMB-YYBMGDPWSA-N | | SMILES | CC(=O)OC(C)(C)\C=C\C(=O)[C@](C)(O)[C@H]1[C@H](O)C[C@@]2(C)[C@@H]3CC=C4[C@@H](C=C(O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)C(=O)C4(C)C)[C@]3(C)C(=O)C[C@]12C |
| RIDADR | UN 2811 6.1 / PGII | | WGK Germany | 1 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Oral |
| | colocynthin Usage And Synthesis |
| Uses | Cucurbitacin E 2-O-Glucoside is a metabolite of Cucurbitacin E (C838800), a highly oxidated steroid consisting of a tetracyclic triterpene. Cucurbitacin E is known to possess broad spectrum of potential anti-inflammatory, antitumor andantioxidant effects. | | Definition | ChEBI: Cucurbitacin E 2-O-beta-D-glucopyranoside is a triterpenoid saponin that is cucurbitacin E attached to a beta-D-glucopyranosyl residue at position 2 via a glycosidic linkage. Isolated from Machilus yaoshansis it exhibits antineoplastic activity. It has a role as a plant metabolite and an antineoplastic agent. It is a cucurbitacin, a beta-D-glucoside, a monosaccharide derivative, a triterpenoid saponin, an acetate ester and a tertiary alpha-hydroxy ketone. It is functionally related to a cucurbitacin E. |
| | colocynthin Preparation Products And Raw materials |
|