| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-METHYL-2-HEPTEN-4-ONE Basic information |
| | 5-METHYL-2-HEPTEN-4-ONE Chemical Properties |
| Melting point | -66.9°C (estimate) | | Boiling point | 170 °C(lit.) | | density | 0.845 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.444(lit.) | | FEMA | 3761 | 5-METHYL-2-HEPTEN-4-ONE | | Fp | 126 °F | | Odor | at 1.00 % in dipropylene glycol. raw nut skin myrcene ketonic sweet hazelnut filbert | | Odor Type | nutty | | biological source | synthetic | | JECFA Number | 1133 | | Major Application | flavors and fragrances | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1S/C8H14O/c1-4-6-8(9)7(3)5-2/h4,6-7H,5H2,1-3H3 | | InChIKey | ARJWAURHQDJJAC-UHFFFAOYSA-N | | SMILES | CC=CC(=O)C(C)CC | | LogP | 1.97 | | CAS DataBase Reference | 81925-81-7(CAS DataBase Reference) | | EPA Substance Registry System | 2-Hepten-4-one, 5-methyl- (81925-81-7) |
| Risk Statements | 10 | | Safety Statements | 16 | | RIDADR | UN 1993 3/PG 1 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | Storage Class | 10 - Combustible liquids |
| | 5-METHYL-2-HEPTEN-4-ONE Usage And Synthesis |
| Description | 5-Methyl-2-hepten-4-one has a hazelnut, metallic, buttery odor
and a hazelnut, buttery, mushroom taste. | | Chemical Properties | 5-Methyl-2-hepten-4-one has a hazelnut, metallic, buttery odor and a hazelnut, buttery, mushroom taste. | | Chemical Properties | (2E)-5-Methyl-2-hepten-4-one has a fruity, hazelnut, and green odor reminding of dried
fruits and a characteristic, nutty, roasted, and nougat-like hazelnut flavor. It was
identified as the character compound of natural hazelnut flavor. Preparation is possible, for example, by Grignard reaction of 2-butyl magnesium chloride with
crotonaldehyde and subsequent oxidation or by reaction of 2-methylbutanoyl
chloride with propene.
The material is used in fragrances as top-note booster in exotic fruit and citrus
notes and in nut, cocoa, coffee, and so on, flavors. | | Occurrence | Reported found in roasted hazelnuts and roasted filberts. | | Aroma threshold values | Aroma characteristics at 1.0%: sweet roasted hazelnuts, rich nutty with a roasted nut skin. | | Taste threshold values | Taste characteristics at 5 ppm: nutty, roasted, coffee, cocoa, brown with an earthy brown and meaty nuance,
sugar fondant, delicate, hazelnut, with macadamia and pecan nuances | | Trade name | Filbertone (Symrise). |
| | 5-METHYL-2-HEPTEN-4-ONE Preparation Products And Raw materials |
|