|
|
| | 4-hydroxy-2-Piperidinone Basic information |
| Product Name: | 4-hydroxy-2-Piperidinone | | Synonyms: | 4-hydroxy-2-Piperidinone;4-Hydroxy-piperidin-2-one;2-Piperidinone, 4-hydroxy-;4-hydroxy-2-Piperidi;4-Hydroxy-2-piperidone;2-Piperidinone, 4-hydroxy- 95%min | | CAS: | 476014-76-3 | | MF: | C5H9NO2 | | MW: | 115.13 | | EINECS: | | | Product Categories: | | | Mol File: | 476014-76-3.mol |  |
| | 4-hydroxy-2-Piperidinone Chemical Properties |
| Melting point | 165-168°C | | Boiling point | 352.3±35.0 °C(Predicted) | | density | 1.199±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Methanol (Slightly, Sonicated) | | pka | 14.01±0.20(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C5H9NO2/c7-4-1-2-6-5(8)3-4/h4,7H,1-3H2,(H,6,8) | | InChIKey | PRCAKTIAKXMBQF-UHFFFAOYSA-N | | SMILES | N1CCC(O)CC1=O |
| | 4-hydroxy-2-Piperidinone Usage And Synthesis |
| Uses | 4-Hydroxy-2-piperidinone is a synthetic intermediate in the synthesis of pharmaceutical goods. | | Synthesis | Step 1) NaBH4 (1 g, 26.55 mmol) was slowly added to a solution of piperidine-2,4-dione (1 g, 8.8 mmol) in methanol (25 mL) at 0°C. The reaction mixture was stirred at room temperature overnight before the solvent was removed by distillation under reduced pressure. The residue was purified by silica gel column chromatography (eluent: dichloromethane/methanol, 5:1, v/v) to afford 4-hydroxy-2-piperidone as a yellow solid (960 mg, 87% yield). m/z by LC-MS (ESI, positive ion mode): 138 [M + Na]+. | | References | [1] Patent: WO2013/138210, 2013, A1. Location in patent: Paragraph 0258
[2] Patent: EP2947085, 2015, A1. Location in patent: Paragraph 0238; 0239; 0240 |
| | 4-hydroxy-2-Piperidinone Preparation Products And Raw materials |
|