|
|
| | POLYHYDROXYSTEARIC ACID Basic information |
| Product Name: | POLYHYDROXYSTEARIC ACID | | Synonyms: | Octadecanoic acid, 12-hydroxy-, homopolymer;POLY(12-HYDROXYSTEARICACID);Polyhydroxystearic acid, mittlere Molmasse 1600 - 1700 g/mol;12-HYDROXYSTEARIC ACID HOMOPOLYMER;POLYHYDROXYSTEARIC ACID;Polyhydroxystearic acid (2300 MW) | | CAS: | 27924-99-8 | | MF: | C18H36O3 | | MW: | 300.48 | | EINECS: | | | Product Categories: | Polymers | | Mol File: | 27924-99-8.mol |  |
| | POLYHYDROXYSTEARIC ACID Chemical Properties |
| Cosmetics Ingredients Functions | SURFACTANT - EMULSIFYING | | InChI | InChI=1S/C18H36O3/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21/h17,19H,2-16H2,1H3,(H,20,21) | | InChIKey | ULQISTXYYBZJSJ-UHFFFAOYSA-N | | SMILES | C(O)(CCCCCC)CCCCCCCCCCC(=O)O | | EPA Substance Registry System | 12-Hydroxystearic acid homopolymer (27924-99-8) |
| | POLYHYDROXYSTEARIC ACID Usage And Synthesis |
| Uses | polyhydroxystearic acid is an emulsifier, also used as a dispersing agent. | | Definition | ChEBI: 12-hydroxyoctadecanoic acid is a hydroxy fatty acid that is stearic acid bearing a hydroxy substituent at position 12. It has a role as a plant metabolite and a bacterial xenobiotic metabolite. It is a hydroxyoctadecanoic acid and a secondary alcohol. It is a conjugate acid of a 12-hydroxyoctadecanoate. |
| | POLYHYDROXYSTEARIC ACID Preparation Products And Raw materials |
|