| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (1S,2R)-1-(2-(HYDROXY-3,5-DI-TERT-BUTYL& Basic information |
| Product Name: | (1S,2R)-1-(2-(HYDROXY-3,5-DI-TERT-BUTYL& | | Synonyms: | (1S,2R)-1-(2-(HYDROXY-3,5-DI-TERT-BUTYL&;(1S,2R)-1-[(3,5-Di-tert-butyl-2-hydroxybenzylidene)amino]-2-indanol 97%;(1S,2R)-1-((3,5-Di-tert-butyl-2-hydroxybenzylidene)amino)-2,3-dihydro-1H-inden-2-ol;1H-Inden-2-ol, 1-[[[3,5-bis(1,1-dimethylethyl)-2-hydroxyphenyl]methylene]amino]-2,3-dihydro-, (1S,2R)-;(1S,2R)-1-[(3,5-Di-tert-butyl-2-hydroxybenzylidene)amino]-2-...;(1S,2R)-1-[(3,5-Di-tert-butyl-2-hydroxybenzylidene)amino]-2-indanol | | CAS: | 212378-89-7 | | MF: | C24H31NO2 | | MW: | 365.51 | | EINECS: | | | Product Categories: | | | Mol File: | 212378-89-7.mol |  |
| | (1S,2R)-1-(2-(HYDROXY-3,5-DI-TERT-BUTYL& Chemical Properties |
| Melting point | 128-131 °C | | form | solid | | InChI | 1S/C24H31NO2/c1-23(2,3)17-11-16(22(27)19(13-17)24(4,5)6)14-25-21-18-10-8-7-9-15(18)12-20(21)26/h7-11,13-14,20-21,26-27H,12H2,1-6H3/b25-14+/t20-,21+/m1/s1 | | InChIKey | MMNHXVSQIRTBOZ-FOYRYCBESA-N | | SMILES | CC(C)(C)c1cc(\C=N\[C@@H]2[C@H](O)Cc3ccccc23)c(O)c(c1)C(C)(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (1S,2R)-1-(2-(HYDROXY-3,5-DI-TERT-BUTYL& Usage And Synthesis |
| Uses | (1S,2R)-1-[(3,5-Di-tert-butyl-2-hydroxybenzylidene)amino]-2-indanol can be used as a ligand to prepare Schiff-base chromium(III) complex, which is used as a catalyst in the synthesis of:
- Poly(cyclohexene carbonate) by coupling of CO2 and cyclohexene oxide.
- β-hydroxyenol ethers by asymmetric hetero-ene reaction between aryl aldehydes and 2-methoxypropene.
|
| | (1S,2R)-1-(2-(HYDROXY-3,5-DI-TERT-BUTYL& Preparation Products And Raw materials |
|